eval $.turtle() # Create the default turtle and global functions. -defaultspeed Infinity +speed Infinity write "Catch blue before red gets you." bk 100 r = hatch red @@ -264,7 +264,7 @@ tick 10, -> fd 6 r.turnto turtle r.fd 4 - b.turnto bearing b + b.turnto direction b b.fd 3 if b.touches(turtle) write "You win!" @@ -331,7 +331,7 @@ element. License (MIT) ------------- -Copyright (c) 2014 Pencil Code, Google, and other contributors +Copyright (c) 2014 Pencil Code, Google Inc., and other contributors Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal diff --git a/bower.json b/bower.json index f2e71d7..4eca85a 100644 --- a/bower.json +++ b/bower.json @@ -2,7 +2,7 @@ "name": "jquery-turtle", "main": "jquery-turtle.js", "ignore": [], - "version": "2.0.8", + "version": "2.0.9", "description": "Turtle graphics plugin for jQuery.", "devDependencies": { "jquery": "latest", diff --git a/jquery-turtle.js b/jquery-turtle.js index f31c0b5..9008141 100644 --- a/jquery-turtle.js +++ b/jquery-turtle.js @@ -4,7 +4,7 @@ jQuery-turtle ============= -version 2.0.8 +version 2.0.9 jQuery-turtle is a jQuery plugin for turtle graphics. @@ -43,7 +43,7 @@ for color in [red, gold, green, blue] lt 360 / sides pen null fd 40 - move 40, -160 + slide 40, -160

eval $.turtle() # Create the default turtle and global functions. -defaultspeed Infinity +speed Infinity write "Catch blue before red gets you." bk 100 r = new Turtle red @@ -368,6 +368,7 @@ THE SOFTWARE. ////////////////////////////////////////////////////////////////////////// var undefined = void 0, + global = this, __hasProp = {}.hasOwnProperty, rootjQuery = jQuery(function() {}), interrupted = false, @@ -752,8 +753,8 @@ function getElementTranslation(elem) { // Reads out the 2x3 transform matrix of the given element. function readTransformMatrix(elem) { - var ts = (window.getComputedStyle ? - window.getComputedStyle(elem)[transform] : + var ts = (global.getComputedStyle ? + global.getComputedStyle(elem)[transform] : $.css(elem, 'transform')); if (!ts || ts === 'none') { return null; @@ -771,7 +772,7 @@ function readTransformMatrix(elem) { // Reads out the css transformOrigin property, if present. function readTransformOrigin(elem, wh) { var hidden = ($.css(elem, 'display') === 'none'), - swapout, old, name, gcs, origin; + swapout, old, name; if (hidden) { // IE GetComputedStyle doesn't give pixel values for transformOrigin // unless the element is unhidden. @@ -782,13 +783,13 @@ function readTransformOrigin(elem, wh) { elem.style[name] = swapout[name]; } } - var gcs = (window.getComputedStyle ? window.getComputedStyle(elem) : null), - origin = (gcs && gcs[transformOrigin] || $.css(elem, 'transformOrigin')); + var gcs = (global.getComputedStyle ? global.getComputedStyle(elem) : null); if (hidden) { for (name in swapout) { elem.style[name] = old[name]; } } + var origin = (gcs && gcs[transformOrigin] || $.css(elem, 'transformOrigin')); if (origin && origin.indexOf('%') < 0) { return $.map(origin.split(' '), parseFloat); } @@ -950,7 +951,8 @@ function cleanedStyle(trans) { // center of rotation when no transforms are applied) in page coordinates. function getTurtleOrigin(elem, inverseParent, extra) { var state = $.data(elem, 'turtleData'); - if (state && state.quickhomeorigin && state.down && state.style && !extra) { + if (state && state.quickhomeorigin && state.down && state.style && !extra + && elem.classList && elem.classList.contains('turtle')) { return state.quickhomeorigin; } var hidden = ($.css(elem, 'display') === 'none'), @@ -958,7 +960,7 @@ function getTurtleOrigin(elem, inverseParent, extra) { { position: "absolute", visibility: "hidden", display: "block" } : {}, substTransform = swapout[transform] = (inverseParent ? 'matrix(' + $.map(inverseParent, cssNum).join(', ') + ', 0, 0)' : 'none'), - old = {}, name, gbcr, transformOrigin, result; + old = {}, name, gbcr, transformOrigin; for (name in swapout) { old[name] = elem.style[name]; elem.style[name] = swapout[name]; @@ -981,12 +983,12 @@ function getTurtleOrigin(elem, inverseParent, extra) { function wh() { // Quirks-mode compatible window height. - return window.innerHeight || $(window).height(); + return global.innerHeight || $(global).height(); } function ww() { // Quirks-mode compatible window width. - return window.innerWidth || $(window).width(); + return global.innerWidth || $(global).width(); } function dh() { @@ -1013,7 +1015,7 @@ function getPageGbcr(elem) { return makeGbcrLTWH(elem.pageX, elem.pageY, 0, 0); } else if ($.isWindow(elem)) { return makeGbcrLTWH( - $(window).scrollLeft(), $(window).scrollTop(), ww(), wh()); + $(global).scrollLeft(), $(global).scrollTop(), ww(), wh()); } else if (elem.nodeType === 9) { return makeGbcrLTWH(0, 0, dw(), dh()); } else if (!('getBoundingClientRect' in elem)) { @@ -1057,10 +1059,10 @@ function polyMatchesGbcr(poly, gbcr) { function readPageGbcr() { var raw = this.getBoundingClientRect(); return { - top: raw.top + window.pageYOffset, - bottom: raw.bottom + window.pageYOffset, - left: raw.left + window.pageXOffset, - right: raw.right + window.pageXOffset, + top: raw.top + global.pageYOffset, + bottom: raw.bottom + global.pageYOffset, + left: raw.left + global.pageXOffset, + right: raw.right + global.pageXOffset, width: raw.width, height: raw.height }; @@ -1088,8 +1090,7 @@ function computeTargetAsTurtlePosition(elem, target, limit, localx, localy) { localTarget = matrixVectorProduct(inverseParent, subtractVector([target.pageX, target.pageY], origin)); if (localx || localy) { - var ts = readTurtleTransform(elem, true), - sy = ts ? ts.sy : 1; + var sy = elemOldScale(elem); localTarget[0] += localx * sy; localTarget[1] -= localy * sy; } @@ -1117,7 +1118,7 @@ function computePositionAsLocalOffset(elem, home) { ts = readTurtleTransform(elem, true), localHome = inverseParent && matrixVectorProduct(inverseParent, subtractVector([home.pageX, home.pageY], origin)), - isy = ts && 1 / ts.sy; + isy = 1 / elemOldScale(elem); if (!inverseParent) { return; } return [(ts.tx - localHome[0]) * isy, (localHome[1] - ts.ty) * isy]; } @@ -1126,11 +1127,12 @@ function convertLocalXyToPageCoordinates(elem, localxy) { var totalParentTransform = totalTransform2x2(elem.parentElement), ts = readTurtleTransform(elem, true), center = $(homeContainer(elem)).pagexy(), + sy = elemOldScale(elem), result = [], pageOffset, j; for (j = 0; j < localxy.length; j++) { pageOffset = matrixVectorProduct( - totalParentTransform, [localxy[j][0] * ts.sy, -localxy[j][1] * ts.sy]); + totalParentTransform, [localxy[j][0] * sy, -localxy[j][1] * sy]); result.push({ pageX: center.pageX + pageOffset[0], pageY: center.pageY + pageOffset[1] }); } @@ -1145,7 +1147,7 @@ function convertLocalXyToPageCoordinates(elem, localxy) { function getCenterInPageCoordinates(elem) { if ($.isWindow(elem)) { return getRoundedCenterLTWH( - $(window).scrollLeft(), $(window).scrollTop(), ww(), wh()); + $(global).scrollLeft(), $(global).scrollTop(), ww(), wh()); } else if (elem.nodeType === 9 || elem == document.body) { return getRoundedCenterLTWH(0, 0, dw(), dh()); } @@ -1160,12 +1162,28 @@ function getCenterInPageCoordinates(elem) { origin = getTurtleOrigin(elem, inverseParent), pos = addVector(matrixVectorProduct(totalParentTransform, tr), origin), result = { pageX: pos[0], pageY: pos[1] }; - if (state && simple && state.down && state.style) { + if (state && simple && state.down && state.style && elem.classList && + elem.classList.contains('turtle')) { state.quickpagexy = result; } return result; } +// The quickpagexy variable is an optimization that assumes +// parent coordinates do not change. This function will clear +// the cache, and is used when we have a container that is moving. +function clearChildQuickLocations(elem) { + if (elem.tagName != 'CANVAS' && elem.tagName != 'IMG') { + $(elem).find('.turtle').each(function(j, e) { + var s = $.data(e, 'turtleData'); + if (s) { + s.quickpagexy = null; + s.quickhomeorigin = null; + } + }); + } +} + function polyToVectorsOffset(poly, offset) { if (!poly) { return null; } var result = [], j = 0; @@ -1180,7 +1198,7 @@ function polyToVectorsOffset(poly, offset) { function getCornersInPageCoordinates(elem, untransformed) { if ($.isWindow(elem)) { return getStraightRectLTWH( - $(window).scrollLeft(), $(window).scrollTop(), ww(), wh()); + $(global).scrollLeft(), $(global).scrollTop(), ww(), wh()); } else if (elem.nodeType === 9) { return getStraightRectLTWH(0, 0, dw(), dh()); } @@ -1227,12 +1245,12 @@ function scrollWindowToDocumentPosition(pos, limit) { b = $('body'), dw = b.width(), dh = b.height(), - w = $(window); + w = $(global); if (tx > dw - ww2) { tx = dw - ww2; } if (tx < ww2) { tx = ww2; } if (ty > dh - wh2) { ty = dh - wh2; } if (ty < wh2) { ty = wh2; } - targ = { pageX: tx, pageY: ty }; + var targ = { pageX: tx, pageY: ty }; if ($.isNumeric(limit)) { targ = limitMovement(w.origin(), targ, limit); } @@ -1486,6 +1504,8 @@ function writeTurtleTransform(ts) { return result.join(' '); } +function modulo(n, m) { return (+n % (m = +m) + m) % m; } + function radiansToDegrees(r) { var d = r * 180 / Math.PI; if (d > 180) { d -= 360; } @@ -1493,7 +1513,7 @@ function radiansToDegrees(r) { } function convertToRadians(d) { - return d * Math.PI / 180; + return d / 180 * Math.PI; } function normalizeRotation(x) { @@ -1568,7 +1588,7 @@ function createSurfaceAndField() { pointerEvents: 'none', overflow: 'hidden' }).addClass('turtlefield'); - $(field).attr('id', 'field') + $(field).attr('id', 'origin') .css({ position: 'absolute', display: 'inline-block', @@ -1579,7 +1599,10 @@ function createSurfaceAndField() { // fixes a "center" point in page coordinates that // will not change even if the document resizes. transformOrigin: "0px 0px", - pointerEvents: 'all' + pointerEvents: 'all', + // Setting turtleSpeed to Infinity by default allows + // moving the origin instantly without sync. + turtleSpeed: Infinity }).appendTo(surface); globalDrawing.surface = surface; globalDrawing.field = field; @@ -1634,7 +1657,7 @@ function getTurtleDrawingCanvas() { surface.insertBefore(globalDrawing.canvas, surface.firstChild); resizecanvas(); pollbodysize(resizecanvas); - $(window).resize(resizecanvas); + $(global).resize(resizecanvas); return globalDrawing.canvas; } @@ -1682,8 +1705,8 @@ function sizexy() { // Using innerHeight || $(window).height() deals with quirks-mode. var b = $('body'); return [ - Math.max(b.outerWidth(true), window.innerWidth || $(window).width()), - Math.max(b.outerHeight(true), window.innerHeight || $(window).height()) + Math.max(b.outerWidth(true), global.innerWidth || $(global).width()), + Math.max(b.outerHeight(true), global.innerHeight || $(global).height()) ]; } @@ -1775,6 +1798,7 @@ function getTurtleData(elem) { drawOnCanvas: null, quickpagexy: null, quickhomeorigin: null, + oldscale: 1, instrument: null, stream: null }); @@ -2018,6 +2042,7 @@ function addToPathList(pathList, point) { } function flushPenState(elem, state, corner) { + clearChildQuickLocations(elem); if (!state) { // Default is no pen and no path, so nothing to do. return; @@ -2031,7 +2056,6 @@ function flushPenState(elem, state, corner) { if (path[0].length) { path[0].length = 0; } if (corner) { if (!style) { - if (window.buggy) console.trace('clearing the retracing path'); // pen null will clear the retracing path too. if (corners.length > 1) corners.length = 1; if (corners[0].length) corners[0].length = 0; @@ -2056,22 +2080,22 @@ function flushPenState(elem, state, corner) { addToPathList(corners[0], center); } if (style.savePath) return; - // Add to tracing path, and trace it righ away. + // Add to tracing path, and trace it right away. addToPathList(path[0], center); - var ts = readTurtleTransform(elem, true); + var scale = drawingScale(elem); // Last argument 2 means that the last two points are saved, which // allows us to draw corner miters and also avoid 'butt' lineCap gaps. - drawAndClearPath(getDrawOnCanvas(state), state.path, style, ts.sx, 2); + drawAndClearPath(getDrawOnCanvas(state), state.path, style, scale, 2); } function endAndFillPenPath(elem, style) { - var ts = readTurtleTransform(elem, true), - state = getTurtleData(elem); + var state = getTurtleData(elem); if (state.style) { // Apply a default style. style = $.extend({}, state.style, style); } - drawAndClearPath(getDrawOnCanvas(state), state.corners, style, ts.sx, 1); + var scale = drawingScale(elem); + drawAndClearPath(getDrawOnCanvas(state), state.corners, style, scale, 1); } function clearField(arg) { @@ -2154,8 +2178,7 @@ function touchesPixel(elem, color) { h = (bb.bottom - bb.top), osc = getOffscreenCanvas(w, h), octx = osc.getContext('2d'), - rgba = rgbaForColor(color), - j = 1, k, data; + j = 1, k; if (!c || c.length < 3 || !w || !h) { return false; } octx.drawImage(canvas, bb.left, bb.top, w, h, 0, 0, w, h); @@ -2183,7 +2206,7 @@ function touchesPixel(elem, color) { } octx.restore(); // Now examine the results and look for alpha > 0%. - data = octx.getImageData(0, 0, w, h).data; + var data = octx.getImageData(0, 0, w, h).data; if (!rgba || rgba[3] == 0) { // Handle the "looking for any color" and "transparent" cases. var wantcolor = !rgba; @@ -2237,8 +2260,9 @@ function applyImg(sel, img, cb) { function doQuickMove(elem, distance, sideways) { var ts = readTurtleTransform(elem, true), r = ts && convertToRadians(ts.rot), - scaledDistance = ts && (distance * ts.sy), - scaledSideways = ts && ((sideways || 0) * ts.sy), + sy = elemOldScale(elem), + scaledDistance = ts && (distance * sy), + scaledSideways = ts && ((sideways || 0) * sy), dy = -Math.cos(r) * scaledDistance, dx = Math.sin(r) * scaledDistance, state = $.data(elem, 'turtleData'), @@ -2285,13 +2309,14 @@ function doQuickRotate(elem, degrees) { } function displacedPosition(elem, distance, sideways) { - var ts = readTurtleTransform(elem, true), - r = ts && convertToRadians(ts.rot), - scaledDistance = ts && (distance * ts.sy), - scaledSideways = ts && ((sideways || 0) * ts.sy), + var ts = readTurtleTransform(elem, true); + if (!ts) { return; } + var s = elemOldScale(elem), + r = convertToRadians(ts.rot), + scaledDistance = distance * s, + scaledSideways = (sideways || 0) * s, dy = -Math.cos(r) * scaledDistance, dx = Math.sin(r) * scaledDistance; - if (!ts) { return; } if (scaledSideways) { dy += Math.sin(r) * scaledSideways; dx += Math.cos(r) * scaledSideways; @@ -2362,16 +2387,18 @@ function makeTurtleForwardHook() { if (ts) { var r = convertToRadians(ts.rot), c = Math.cos(r), - s = Math.sin(r); + s = Math.sin(r), + sy = elemOldScale(elem); return cssNum(((ts.tx + middle[0]) * s - (ts.ty + middle[1]) * c) - / ts.sy) + 'px'; + / sy) + 'px'; } }, set: function(elem, value) { var ts = readTurtleTransform(elem, true) || {tx: 0, ty: 0, rot: 0, sx: 1, sy: 1, twi: 0}, middle = readTransformOrigin(elem), - v = parseFloat(value) * ts.sy, + sy = elemOldScale(elem), + v = parseFloat(value) * sy, r = convertToRadians(ts.rot), c = Math.cos(r), s = Math.sin(r), @@ -2417,6 +2444,8 @@ function makeTurtleHook(prop, normalize, unit, displace) { }; } flushPenState(elem, state); + } else { + clearChildQuickLocations(elem); } } }; @@ -2519,7 +2548,8 @@ function maybeArcRotation(end, elem, ts, opt) { return tradius === 0 ? normalizeRotation(end) : end; } var tracing = (state && state.style && state.down), - turnradius = tradius * ts.sy, a; + sy = (state && state.oldscale) ? ts.sy : 1, + turnradius = tradius * sy, a; if (tracing) { a = addArcBezierPaths( state.path[0], // path to add to @@ -2609,6 +2639,8 @@ function makeTurtleXYHook(publicname, propx, propy, displace) { }; } flushPenState(elem, state); + } else { + clearChildQuickLocations(elem); } } }; @@ -2645,7 +2677,7 @@ function apiUrl(url, topdir) { result = link.protocol + '//' + link.host + '/' + topdir + '/' + link.pathname.replace(/\/[^\/]*(?:\/|$)/, '') + link.search + link.hash; } - } else if (isPencilHost(window.location.hostname)) { + } else if (isPencilHost(global.location.hostname)) { // Proxy offdomain requests to avoid CORS issues. result = '/proxy/' + result; } @@ -2655,8 +2687,8 @@ function apiUrl(url, topdir) { function imgUrl(url) { if (/\//.test(url)) { return url; } url = '/img/' + url; - if (isPencilHost(window.location.hostname)) { return url; } - return '//pencil.io' + url; + if (isPencilHost(global.location.hostname)) { return url; } + return '//pencilcode.net' + url; } // Retrieves the pencil code login cookie, if there is one. function loginCookie() { @@ -2693,7 +2725,8 @@ var stablyLoadedImages = {}; // @param css is a dictionary of css props to set when the image is loaded. // @param cb is an optional callback, called after the loading is done. function setImageWithStableOrigin(elem, url, css, cb) { - var record, urlobj = absoluteUrlObject(url), url = urlobj.href; + var record, urlobj = absoluteUrlObject(url); + url = urlobj.href; // The data-loading attr will always reflect the last URL requested. elem.setAttribute('data-loading', url); if (url in stablyLoadedImages) { @@ -2999,7 +3032,7 @@ var Pencil = (function(_super) { } // The pencil is a sprite that just defaults to zero size. var context = canvas ? canvas.parentElement : null; - var settings = { width: 0, height: 0, color: transparent }; + var settings = { width: 0, height: 0, color: 'transparent' }; Pencil.__super__.constructor.call(this, settings, context); // Set the pencil to hidden, infinite speed, // and drawing on the specifed canvas. @@ -3039,7 +3072,7 @@ var Webcam = (function(_super) { function Webcam(opts, context) { var attrs = "", hassrc = false, hasautoplay = false, hasdims = false; if ($.isPlainObject(opts)) { - for (key in opts) { + for (var key in opts) { attrs += ' ' + key + '="' + escapeHtml(opts[key]) + '"'; } hassrc = ('src' in opts); @@ -3082,7 +3115,7 @@ var Webcam = (function(_super) { $(v).off('play.capture' + k); next(); }); - v.src = window.URL.createObjectURL(stream); + v.src = global.URL.createObjectURL(stream); } }, function() { next(); @@ -3284,12 +3317,12 @@ var Piano = (function(_super) { // Converts a midi number to a white key position (black keys round left). function wcp(n) { - return floor((n + 7) / 12 * 7); + return Math.floor((n + 7) / 12 * 7); }; // Converts from a white key position to a midi number. function mcp(n) { - return ceil(n / 7 * 12) - 7; + return Math.ceil(n / 7 * 12) - 7; }; // True if midi #n is a black key. @@ -3398,14 +3431,14 @@ function focusWindowIfFirst() { try { // If we are in a frame with access to a parent with an activeElement, // then try to blur it (as is common inside the pencilcode IDE). - window.parent.document.activeElement.blur(); + global.parent.document.activeElement.blur(); } catch (e) {} - window.focus(); + global.focus(); } // Construction of keyCode names. var keyCodeName = (function() { - var ua = typeof window !== 'undefined' ? window.navigator.userAgent : '', + var ua = typeof global !== 'undefined' ? global.navigator.userAgent : '', isOSX = /OS X/.test(ua), isOpera = /Opera/.test(ua), maybeFirefox = !/like Gecko/.test(ua) && !isOpera, @@ -3585,9 +3618,9 @@ var pressedKey = (function() { resetPressedState(); for (var name in eventMap) { if (turnon) { - window.addEventListener(name, eventMap[name], true); + global.addEventListener(name, eventMap[name], true); } else { - window.removeEventListener(name, eventMap[name]); + global.removeEventListener(name, eventMap[name]); } } } @@ -3695,7 +3728,7 @@ function forwardBodyMouseEventsIfNeeded() { var warn = $.turtle.nowarn; $.turtle.nowarn = true; var sel = $(globalDrawing.surface) - .find('.turtle').within('touch', e).eq(0); + .find('.turtle,.turtlelabel').within('touch', e).eq(0); $.turtle.nowarn = warn; if (sel.length === 1) { // Erase portions of the event that are wrong for the turtle. @@ -3829,9 +3862,11 @@ function getGlobalInstrument() { return global_instrument; } +// Beginning of musical.js copy + // Tests for the presence of HTML5 Web Audio (or webkit's version). function isAudioPresent() { - return !!(window.AudioContext || window.webkitAudioContext); + return !!(global.AudioContext || global.webkitAudioContext); } // All our audio funnels through the same AudioContext with a @@ -3842,7 +3877,7 @@ function getAudioTop() { if (!isAudioPresent()) { return null; } - var ac = new (window.AudioContext || window.webkitAudioContext); + var ac = new (global.AudioContext || global.webkitAudioContext); getAudioTop.audioTop = { ac: ac, wavetable: makeWavetable(ac), @@ -3864,11 +3899,16 @@ function resetAudio() { atop.out = null; atop.currentStart = null; } - var dcn = atop.ac.createDynamicsCompressor(); - dcn.ratio = 16; - dcn.attack = 0.0005; - dcn.connect(atop.ac.destination); - atop.out = dcn; + // If resetting due to interrupt after AudioContext closed, this can fail. + try { + var dcn = atop.ac.createDynamicsCompressor(); + dcn.ratio = 16; + dcn.attack = 0.0005; + dcn.connect(atop.ac.destination); + atop.out = dcn; + } catch (e) { + getAudioTop.audioTop = null; + } } } @@ -3887,6 +3927,48 @@ function audioCurrentStartTime() { return atop.currentStart; } +// Converts a midi note number to a frequency in Hz. +function midiToFrequency(midi) { + return 440 * Math.pow(2, (midi - 69) / 12); +} +// Some constants. +var noteNum = + {C:0,D:2,E:4,F:5,G:7,A:9,B:11,c:12,d:14,e:16,f:17,g:19,a:21,b:23}; +var accSym = + { '^':1, '': 0, '=':0, '_':-1 }; +var noteName = + ['C', '^C', 'D', '_E', 'E', 'F', '^F', 'G', '_A', 'A', '_B', 'B', + 'c', '^c', 'd', '_e', 'e', 'f', '^f', 'g', '_a', 'a', '_b', 'b']; +// Converts a frequency in Hz to the closest midi number. +function frequencyToMidi(freq) { + return Math.round(69 + Math.log(freq / 440) * 12 / Math.LN2); +} +// Converts an ABC pitch (such as "^G,,") to a midi note number. +function pitchToMidi(pitch) { + var m = /^(\^+|_+|=|)([A-Ga-g])([,']*)$/.exec(pitch); + if (!m) { return null; } + var octave = m[3].replace(/,/g, '').length - m[3].replace(/'/g, '').length; + var semitone = + noteNum[m[2]] + accSym[m[1].charAt(0)] * m[1].length + 12 * octave; + return semitone + 60; // 60 = midi code middle "C". +} +// Converts a midi number to an ABC notation pitch. +function midiToPitch(midi) { + var index = ((midi - 72) % 12); + if (midi > 60 || index != 0) { index += 12; } + var octaves = Math.round((midi - index - 60) / 12), + result = noteName[index]; + while (octaves != 0) { + result += octaves > 0 ? "'" : ","; + octaves += octaves > 0 ? -1 : 1; + } + return result; +} +// Converts an ABC pitch to a frequency in Hz. +function pitchToFrequency(pitch) { + return midiToFrequency(pitchToMidi(pitch)); +} + // All further details of audio handling are encapsulated in the Instrument // class, which knows how to synthesize a basic timbre; how to play and // schedule a tone; and how to parse and sequence a song written in ABC @@ -3926,6 +4008,7 @@ var Instrument = (function() { } } + Instrument.timeOffset = 0.0625;// Seconds to delay all audiable timing. Instrument.dequeueTime = 0.5; // Seconds before an event to reexamine queue. Instrument.bufferSecs = 2; // Seconds ahead to put notes in WebAudio. Instrument.toneLength = 1; // Default duration of a tone. @@ -4062,7 +4145,7 @@ var Instrument = (function() { // node graph for the tone generators and filters for the tone. Instrument.prototype._makeSound = function(record) { var timbre = record.timbre || this._timbre, - starttime = record.time, + starttime = record.time + Instrument.timeOffset, releasetime = starttime + record.duration, attacktime = Math.min(releasetime, starttime + timbre.attack), decaytime = timbre.decay * @@ -4139,12 +4222,13 @@ var Instrument = (function() { // Truncates a sound previously scheduled by _makeSound by using // cancelScheduledValues and directly ramping down to zero. // Can only be used to shorten a sound. - Instrument.prototype._truncateSound = function(record, releasetime) { - if (releasetime < record.time + record.duration) { - record.duration = Math.max(0, releasetime - record.time); + Instrument.prototype._truncateSound = function(record, truncatetime) { + if (truncatetime < record.time + record.duration) { + record.duration = Math.max(0, truncatetime - record.time); if (record.gainNode) { var timbre = record.timbre || this._timbre, - starttime = record.time, + starttime = record.time + Instrument.timeOffset, + releasetime = truncatetime + Instrument.timeOffset, attacktime = Math.min(releasetime, starttime + timbre.attack), decaytime = timbre.decay * Math.pow(440 / record.frequency, timbre.decayfollow), @@ -4161,7 +4245,8 @@ var Instrument = (function() { } else if (releasetime <= attacktime) { // Release before attack is done? Interrupt ramp up. g.gain.linearRampToValueAtTime( - amp * (releasetime - starttime) / (attacktime - starttime)); + amp * (releasetime - starttime) / (attacktime - starttime), + releasetime); } else { // Release during decay? Interrupt decay down. g.gain.setValueAtTime(amp * (timbre.sustain + (1 - timbre.sustain) * @@ -4433,7 +4518,7 @@ var Instrument = (function() { if (key in given) { timbre[key] = given[key]; } else { - timbre[key] = defaulTimbre[key]; + timbre[key] = defaultTimbre[key]; } } } @@ -4583,150 +4668,399 @@ var Instrument = (function() { } }; - // Parses an ABC file to an object with the following structure: - // { - // X: value from the X: lines in header (\n separated for multiple values) - // V: value from the V:myname lines that appear before K: - // (etc): for all the one-letter header-names. - // K: value from the K: lines in header. - // tempo: Q: line parsed as beatsecs - // timbre: ... I:timbre line as parsed by makeTimbre - // voice: { - // myname: { // voice with id "myname" - // V: value from the V:myname lines (from the body) - // stems: [...] as parsed by parseABCstems - // } - // } - // } - // ABC files are idiosyncratic to parse: the written specifications - // do not necessarily reflect the defacto standard implemented by - // ABC content on the web. This implementation is designed to be - // practical, working on content as it appears on the web, and only - // using the written standard as a guideline. - var ABCheader = /^([A-Za-z]):\s*(.*)$/; - function parseABCFile(str) { - var lines = str.split('\n'), - result = { - voice: {} - }, - context = result, timbre, - j, k, header, stems, key = {}, accent = {}, voiceid, out; - // Shifts context to a voice with the given id given. If no id - // given, then just sticks with the current voice. If the current - // voice is unnamed and empty, renames the current voice. - function startVoiceContext(id) { - id = id || ''; - if (!id && context !== result) { - return; - } - if (result.voice.hasOwnProperty(id)) { - // Resume a named voice. - context = result.voice[id]; - accent = context.accent; - } else { - // Start a new voice. - context = { id: id, accent: { slurred: 0 } }; - result.voice[id] = context; - accent = context.accent; - } + + // The default sound is a square wave with a pretty quick decay to zero. + var defaultTimbre = Instrument.defaultTimbre = { + wave: 'square', // Oscillator type. + gain: 0.1, // Overall gain at maximum attack. + attack: 0.002, // Attack time at the beginning of a tone. + decay: 0.4, // Rate of exponential decay after attack. + decayfollow: 0, // Amount of decay shortening for higher notes. + sustain: 0, // Portion of gain to sustain indefinitely. + release: 0.1, // Release time after a tone is done. + cutoff: 0, // Low-pass filter cutoff frequency. + cutfollow: 0, // Cutoff adjustment, a multiple of oscillator freq. + resonance: 0, // Low-pass filter resonance. + detune: 0 // Detune factor for a second oscillator. + }; + + // Norrmalizes a timbre object by making a copy that has exactly + // the right set of timbre fields, defaulting when needed. + // A timbre can specify any of the fields of defaultTimbre; any + // unspecified fields are treated as they are set in defaultTimbre. + function makeTimbre(options, atop) { + if (!options) { + options = {}; } - // For picking a default voice, looks for the first voice name. - function firstVoiceName() { - if (result.V) { - return result.V.split(/\s+/)[0]; - } else { - return ''; + if (typeof(options) == 'string') { + // Abbreviation: name a wave to get a default timbre for that wave. + options = { wave: options }; + } + var result = {}, key, + wt = atop && atop.wavetable && atop.wavetable[options.wave]; + for (key in defaultTimbre) { + if (options.hasOwnProperty(key)) { + result[key] = options[key]; + } else if (wt && wt.defs && wt.defs.hasOwnProperty(key)) { + result[key] = wt.defs[key]; + } else{ + result[key] = defaultTimbre[key]; } } - // ABC files are parsed one line at a time. - for (j = 0; j < lines.length; ++j) { - // First, check to see if the line is a header line. - header = ABCheader.exec(lines[j]); - if (header) { - // The following headers are recognized and processed. - switch(header[1]) { - case 'V': - // A V: header switches voices if in the body. - // If in the header, then it is just advisory. - if (context !== result) { - startVoiceContext(header[2].split(' ')[0]); + return result; + } + + function getWhiteNoiseBuf() { + var ac = getAudioTop().ac, + bufferSize = 2 * ac.sampleRate, + whiteNoiseBuf = ac.createBuffer(1, bufferSize, ac.sampleRate), + output = whiteNoiseBuf.getChannelData(0); + for (var i = 0; i < bufferSize; i++) { + output[i] = Math.random() * 2 - 1; + } + return whiteNoiseBuf; + } + + // This utility function creates an oscillator at the given frequency + // and the given wavename. It supports lookups in a static wavetable, + // defined right below. + function makeOscillator(atop, wavename, freq) { + if (wavename == 'noise') { + var whiteNoise = atop.ac.createBufferSource(); + whiteNoise.buffer = getWhiteNoiseBuf(); + whiteNoise.loop = true; + return whiteNoise; + } + var wavetable = atop.wavetable, o = atop.ac.createOscillator(), + k, pwave, bwf, wf; + try { + if (wavetable.hasOwnProperty(wavename)) { + // Use a customized wavetable. + pwave = wavetable[wavename].wave; + if (wavetable[wavename].freq) { + bwf = 0; + // Look for a higher-frequency variant. + for (k in wavetable[wavename].freq) { + wf = Number(k); + if (freq > wf && wf > bwf) { + bwf = wf; + pwave = wavetable[wavename].freq[bwf]; } - break; - case 'M': - parseMeter(header[2], context); - break; - case 'L': - parseUnitNote(header[2], context); - break; - case 'Q': - parseTempo(header[2], context); - break; + } } - // All headers (including unrecognized ones) are - // just accumulated as properties. Repeated header - // lines are accumulated as multiline properties. - if (context.hasOwnProperty(header[1])) { - context[header[1]] += '\n' + header[2]; + if (!o.setPeriodicWave && o.setWaveTable) { + // The old API name: Safari 7 still uses this. + o.setWaveTable(pwave); } else { - context[header[1]] = header[2]; - } - // The K header is special: it should be the last one - // before the voices and notes begin. - if (header[1] == 'K' && context === result) { - key = keysig(header[2]); - startVoiceContext(firstVoiceName()); + // The new API name. + o.setPeriodicWave(pwave); } - } else if (/^\s*(?:%.*)?$/.test(lines[j])) { - // Skip blank and comment lines. - continue; } else { - // A non-blank non-header line should have notes. - voiceid = peekABCVoice(lines[j]); - if (voiceid) { - // If it declares a voice id, respect it. - startVoiceContext(voiceid); - } else { - // Otherwise, start a default voice. - if (context === result) { - startVoiceContext(firstVoiceName()); + o.type = wavename; + } + } catch(e) { + if (window.console) { window.console.log(e); } + // If unrecognized, just use square. + // TODO: support "noise" or other wave shapes. + o.type = 'square'; + } + o.frequency.value = freq; + return o; + } + + // Accepts either an ABC pitch or a midi number and converts to midi. + Instrument.pitchToMidi = function(n) { + if (typeof(n) == 'string') { return pitchToMidi(n); } + return n; + } + + // Accepts either an ABC pitch or a midi number and converts to ABC pitch. + Instrument.midiToPitch = function(n) { + if (typeof(n) == 'number') { return midiToPitch(n); } + return n; + } + + return Instrument; +})(); + +// Parses an ABC file to an object with the following structure: +// { +// X: value from the X: lines in header (\n separated for multiple values) +// V: value from the V:myname lines that appear before K: +// (etc): for all the one-letter header-names. +// K: value from the K: lines in header. +// tempo: Q: line parsed as beatsecs +// timbre: ... I:timbre line as parsed by makeTimbre +// voice: { +// myname: { // voice with id "myname" +// V: value from the V:myname lines (from the body) +// stems: [...] as parsed by parseABCstems +// } +// } +// } +// ABC files are idiosyncratic to parse: the written specifications +// do not necessarily reflect the defacto standard implemented by +// ABC content on the web. This implementation is designed to be +// practical, working on content as it appears on the web, and only +// using the written standard as a guideline. +var ABCheader = /^([A-Za-z]):\s*(.*)$/; +var ABCtoken = /(?:\[[A-Za-z]:[^\]]*\])|\s+|%[^\n]*|![^\s!:|\[\]]*!|\+[^+|!]*\+|[_<>@^]?"[^"]*"|\[|\]|>+|<+|(?:(?:\^+|_+|=|)[A-Ga-g](?:,+|'+|))|\(\d+(?::\d+){0,2}|\d*\/\d+|\d+\/?|\/+|[xzXZ]|\[?\|\]?|:?\|:?|::|./g; +function parseABCFile(str) { + var lines = str.split('\n'), + result = {}, + context = result, timbre, + j, k, header, stems, key = {}, accent = { slurred: 0 }, voiceid, out; + // ABC files are parsed one line at a time. + for (j = 0; j < lines.length; ++j) { + // First, check to see if the line is a header line. + header = ABCheader.exec(lines[j]); + if (header) { + handleInformation(header[1], header[2].trim()); + } else if (/^\s*(?:%.*)?$/.test(lines[j])) { + // Skip blank and comment lines. + continue; + } else { + // Parse the notes. + parseABCNotes(lines[j]); + } + } + var infer = ['unitnote', 'unitbeat', 'tempo']; + if (result.voice) { + out = []; + for (j in result.voice) { + if (result.voice[j].stems && result.voice[j].stems.length) { + // Calculate times for all the tied notes. This happens at the end + // because in principle, the first note of a song could be tied all + // the way through to the last note. + processTies(result.voice[j].stems); + // Bring up inferred tempo values from voices if not specified + // in the header. + for (k = 0; k < infer.length; ++k) { + if (!(infer[k] in result) && (infer[k] in result.voice[j])) { + result[infer[k]] = result.voice[j][infer[k]]; } } - // Parse the notes. - stems = parseABCNotes(lines[j], key, accent); - if (stems && stems.length) { - // Push the line of stems into the voice. - if (!('stems' in context)) { context.stems = []; } - context.stems.push.apply(context.stems, stems); + // Remove this internal state variable; + delete result.voice[j].accent; + } else { + out.push(j); + } + } + // Delete any voices that had no stems. + for (j = 0; j < out.length; ++j) { + delete result.voice[out[j]]; + } + } + return result; + + + //////////////////////////////////////////////////////////////////////// + // Parsing helper functions below. + //////////////////////////////////////////////////////////////////////// + + + // Processes header fields such as V: voice, which may appear at the + // top of the ABC file, or in the ABC body in a [V:voice] directive. + function handleInformation(field, value) { + // The following headers are recognized and processed. + switch(field) { + case 'V': + // A V: header switches voices if in the body. + // If in the header, then it is just advisory. + if (context !== result) { + startVoiceContext(value.split(' ')[0]); } + break; + case 'M': + parseMeter(value, context); + break; + case 'L': + parseUnitNote(value, context); + break; + case 'Q': + parseTempo(value, context); + break; + } + // All headers (including unrecognized ones) are + // just accumulated as properties. Repeated header + // lines are accumulated as multiline properties. + if (context.hasOwnProperty(field)) { + context[field] += '\n' + value; + } else { + context[field] = value; + } + // The K header is special: it should be the last one + // before the voices and notes begin. + if (field == 'K') { + key = keysig(value); + if (context === result) { + startVoiceContext(firstVoiceName()); } } - var infer = ['unitnote', 'unitbeat', 'tempo']; - if (result.voice) { - out = []; - for (j in result.voice) { - if (result.voice[j].stems && result.voice[j].stems.length) { - // Calculate times for all the tied notes. This happens at the end - // because in principle, the first note of a song could be tied all - // the way through to the last note. - processTies(result.voice[j].stems); - // Bring up inferred tempo values from voices if not specified - // in the header. - for (k = 0; k < infer.length; ++k) { - if (!(infer[k] in result) && (infer[k] in result.voice[j])) { - result[infer[k]] = result.voice[j][infer[k]]; + } + + // Shifts context to a voice with the given id given. If no id + // given, then just sticks with the current voice. If the current + // voice is unnamed and empty, renames the current voice. + function startVoiceContext(id) { + id = id || ''; + if (!id && context !== result) { + return; + } + if (!result.voice) { + result.voice = {}; + } + if (result.voice.hasOwnProperty(id)) { + // Resume a named voice. + context = result.voice[id]; + accent = context.accent; + } else { + // Start a new voice. + context = { id: id, accent: { slurred: 0 } }; + result.voice[id] = context; + accent = context.accent; + } + } + + // For picking a default voice, looks for the first voice name. + function firstVoiceName() { + if (result.V) { + return result.V.split(/\s+/)[0]; + } else { + return ''; + } + } + + // Parses a single line of ABC notes (i.e., not a header line). + // + // We process an ABC song stream by dividing it into tokens, each of + // which is a pitch, duration, or special decoration symbol; then + // we process each decoration individually, and we process each + // stem as a group using parseStem. + // The structure of a single ABC note is something like this: + // + // NOTE -> STACCATO? PITCH DURATION? TIE? + // + // I.e., it always has a pitch, and it is prefixed by some optional + // decorations such as a (.) staccato marking, and it is suffixed by + // an optional duration and an optional tie (-) marking. + // + // A stem is either a note or a bracketed series of notes, followed + // by duration and tie. + // + // STEM -> NOTE OR '[' NOTE * ']' DURAITON? TIE? + // + // Then a song is just a sequence of stems interleaved with other + // decorations such as dynamics markings and measure delimiters. + function parseABCNotes(str) { + var tokens = str.match(ABCtoken), parsed = null, + index = 0, dotted = 0, beatlet = null, t; + if (!tokens) { + return null; + } + while (index < tokens.length) { + // Ignore %comments and !markings! + if (/^[\s%]/.test(tokens[index])) { index++; continue; } + // Handle inline [X:...] information fields + if (/^\[[A-Za-z]:[^\]]*\]$/.test(tokens[index])) { + handleInformation( + tokens[index].substring(1, 2), + tokens[index].substring(3, tokens[index].length - 1).trim() + ); + index++; + continue; + } + // Handled dotted notation abbreviations. + if (//.test(tokens[index])) { + dotted = tokens[index++].length; + continue; + } + if (/^\(\d+(?::\d+)*/.test(tokens[index])) { + beatlet = parseBeatlet(tokens[index++]); + continue; + } + if (/^[!+].*[!+]$/.test(tokens[index])) { + parseDecoration(tokens[index++], accent); + continue; + } + if (/^.?".*"$/.test(tokens[index])) { + // Ignore double-quoted tokens (chords and general text annotations). + index++; + continue; + } + if (/^[()]$/.test(tokens[index])) { + if (tokens[index++] == '(') { + accent.slurred += 1; + } else { + accent.slurred -= 1; + if (accent.slurred <= 0) { + accent.slurred = 0; + if (context.stems && context.stems.length >= 1) { + // The last notes in a slur are not slurred. + slurStem(context.stems[context.stems.length - 1], false); } } + } + continue; + } + // Handle measure markings by clearing accidentals. + if (/\|/.test(tokens[index])) { + for (t in accent) { + if (t.length == 1) { + // Single-letter accent properties are note accidentals. + delete accent[t]; + } + } + index++; + continue; + } + parsed = parseStem(tokens, index, key, accent); + // Skip unparsable bits + if (parsed === null) { + index++; + continue; + } + // Process a parsed stem. + if (beatlet) { + scaleStem(parsed.stem, beatlet.time); + beatlet.count -= 1; + if (!beatlet.count) { + beatlet = null; + } + } + // If syncopated with > or < notation, shift part of a beat + // between this stem and the previous one. + if (dotted && context.stems && context.stems.length) { + if (dotted > 0) { + t = (1 - Math.pow(0.5, dotted)) * parsed.stem.time; } else { - out.push(j); + t = (Math.pow(0.5, -dotted) - 1) * + context.stems[context.stems.length - 1].time; } + syncopateStem(context.stems[context.stems.length - 1], t); + syncopateStem(parsed.stem, -t); + } + dotted = 0; + // Slur all the notes contained within a strem. + if (accent.slurred) { + slurStem(parsed.stem, true); } - // Delete any voices that had no stems. - for (j = 0; j < out.length; ++j) { - delete result.voice[out[j]]; + // Start a default voice if we're not in a voice yet. + if (context === result) { + startVoiceContext(firstVoiceName()); } + if (!('stems' in context)) { context.stems = []; } + // Add the stem to the sequence of stems for this voice. + context.stems.push(parsed.stem); + // Advance the parsing index since a stem is multiple tokens. + index = parsed.index; } - return result; } + // Parse M: lines. "3/4" is 3/4 time and "C" is 4/4 (common) time. function parseMeter(mline, beatinfo) { var d = /^C/.test(mline) ? 4/4 : durationToTime(mline); @@ -4811,7 +5145,7 @@ var Instrument = (function() { // Supports the whole range of scale systems listed in the ABC spec. function keysig(keyname) { if (!keyname) { return {}; } - var key, sigcodes = { + var kkey, sigcodes = { // Major 'c#':7, 'f#':6, 'b':5, 'e':4, 'a':3, 'd':2, 'g':1, 'c':0, 'f':-1, 'bb':-2, 'eb':-3, 'ab':-4, 'db':-5, 'gb':-6, 'cb':-7, @@ -4843,19 +5177,19 @@ var Instrument = (function() { var scale = k.match(/maj|min|mix|dor|phr|lyd|loc|m/); if (scale) { if (scale == 'maj') { - key = k.substr(0, scale.index); + kkey = k.substr(0, scale.index); } else if (scale == 'min') { - key = k.substr(0, scale.index + 1); + kkey = k.substr(0, scale.index + 1); } else { - key = k.substr(0, scale.index + scale[0].length); + kkey = k.substr(0, scale.index + scale[0].length); } } else { - key = /^[a-g][#b]?/.exec(k) || ''; + kkey = /^[a-g][#b]?/.exec(k) || ''; } - var result = accidentals(sigcodes[key]); - var extras = keyname.substr(key.length).match(/(_+|=|\^+)[a-g]/ig); + var result = accidentals(sigcodes[kkey]); + var extras = keyname.substr(kkey.length).match(/(_+|=|\^+)[a-g]/ig); if (extras) { - for (j = 0; j < extras.length; ++j) { + for (var j = 0; j < extras.length; ++j) { var note = extras[j].charAt(extras[j].length - 1).toUpperCase(); if (extras[j].charAt(0) == '=') { delete result[note]; @@ -4866,138 +5200,10 @@ var Instrument = (function() { } return result; } - // Peeks and looks for a prefix of the form [V:voiceid]. - function peekABCVoice(line) { - var match = /^\[V:([^\]\s]*)\]/.exec(line); - if (!match) return null; - return match[1]; - } - // Parses a single line of ABC notes (i.e., not a header line). - // - // We process an ABC song stream by dividing it into tokens, each of - // which is a pitch, duration, or special decoration symbol; then - // we process each decoration individually, and we process each - // stem as a group using parseStem. - // The structure of a single ABC note is something like this: - // - // NOTE -> STACCATO? PITCH DURATION? TIE? - // - // I.e., it always has a pitch, and it is prefixed by some optional - // decorations such as a (.) staccato marking, and it is suffixed by - // an optional duration and an optional tie (-) marking. - // - // A stem is either a note or a bracketed series of notes, followed - // by duration and tie. - // - // STEM -> NOTE OR '[' NOTE * ']' DURAITON? TIE? - // - // Then a song is just a sequence of stems interleaved with other - // decorations such as dynamics markings and measure delimiters. - var ABCtoken = /(?:^\[V:[^\]\s]*\])|\s+|%[^\n]*|![^\s!:|\[\]]*!|\+[^+|!]*\+|[_<>@^]?"[^"]*"|\[|\]|>+|<+|(?:(?:\^+|_+|=|)[A-Ga-g](?:,+|'+|))|\(\d+(?::\d+){0,2}|\d*\/\d+|\d+\/?|\/+|[xzXZ]|\[?\|\]?|:?\|:?|::|./g; - function parseABCNotes(str, key, accent) { - var tokens = str.match(ABCtoken), result = [], parsed = null, - index = 0, dotted = 0, beatlet = null, t; - if (!tokens) { - return null; - } - while (index < tokens.length) { - // Ignore %comments and !markings! - if (/^[\s%]/.test(tokens[index])) { index++; continue; } - if (/^\[V:\S*\]$/.test(tokens[index])) { - // Voice id from [V:id] is handled in peekABCVoice. - index++; - continue; - } - // Handled dotted notation abbreviations. - if (//.test(tokens[index])) { - dotted = tokens[index++].length; - continue; - } - if (/^\(\d+(?::\d+)*/.test(tokens[index])) { - beatlet = parseBeatlet(tokens[index++]); - continue; - } - if (/^[!+].*[!+]$/.test(tokens[index])) { - parseDecoration(tokens[index++], accent); - continue; - } - if (/^.?".*"$/.test(tokens[index])) { - // Ignore double-quoted tokens (chords and general text annotations). - index++; - continue; - } - if (/^[()]$/.test(tokens[index])) { - if (tokens[index++] == '(') { - accent.slurred += 1; - } else { - accent.slurred -= 1; - if (accent.slurred <= 0) { - accent.slurred = 0; - if (result.length >= 1) { - // The last notes in a slur are not slurred. - slurStem(result[result.length - 1], false); - } - } - } - continue; - } - // Handle measure markings by clearing accidentals. - if (/\|/.test(tokens[index])) { - for (t in accent) { - if (t.length == 1) { - // Single-letter accent properties are note accidentals. - delete accent[t]; - } - } - index++; - continue; - } - parsed = parseStem(tokens, index, key, accent); - // Skip unparsable bits - if (parsed === null) { - index++; - continue; - } - // Process a parsed stem. - if (beatlet) { - scaleStem(parsed.stem, beatlet.time); - beatlet.count -= 1; - if (!beatlet.count) { - beatlet = null; - } - } - // If syncopated with > or < notation, shift part of a beat - // between this stem and the previous one. - if (dotted && result.length) { - if (dotted > 0) { - t = (1 - Math.pow(0.5, dotted)) * parsed.stem.time; - } else { - t = (Math.pow(0.5, -dotted) - 1) * result[result.length - 1].time; - } - syncopateStem(result[result.length - 1], t); - syncopateStem(parsed.stem, -t); - } - dotted = 0; - // Slur all the notes contained within a strem. - if (accent.slurred) { - slurStem(parsed.stem, true); - } - // Add the stem to the sequence of stems for this voice. - result.push(parsed.stem); - // Advance the parsing index since a stem is multiple tokens. - index = parsed.index; - } - return result; - } // Additively adjusts the beats for a stem and the contained notes. function syncopateStem(stem, t) { var j, note, stemtime = stem.time, newtime = stemtime + t; stem.time = newtime; - syncopateStem for (j = 0; j < stem.notes.length; ++j) { note = stem.notes[j]; // Only adjust a note's duration if it matched the stem's duration. @@ -5212,195 +5418,38 @@ var Instrument = (function() { if (m[1].length > 0) { // When there is an explicit accidental, then remember it for // the rest of the measure. - accent[letter] = m[1]; - return stripNatural(pitch); - } - if (accent.hasOwnProperty(letter)) { - // Accidentals from this measure apply to unaccented notes. - return stripNatural(accent[letter] + m[2] + m[3]); - } - if (key.hasOwnProperty(letter)) { - // Key signatures apply by default. - return stripNatural(key[letter] + m[2] + m[3]); - } - return stripNatural(pitch); - } - // Converts a midi note number to a frequency in Hz. - function midiToFrequency(midi) { - return 440 * Math.pow(2, (midi - 69) / 12); - } - // Some constants. - var noteNum = - {C:0,D:2,E:4,F:5,G:7,A:9,B:11,c:12,d:14,e:16,f:17,g:19,a:21,b:23}; - var accSym = - { '^':1, '': 0, '=':0, '_':-1 }; - var noteName = - ['C', '^C', 'D', '_E', 'E', 'F', '^F', 'G', '_A', 'A', '_B', 'B', - 'c', '^c', 'd', '_e', 'e', 'f', '^f', 'g', '_a', 'a', '_b', 'b']; - // Converts a frequency in Hz to the closest midi number. - function frequencyToMidi(freq) { - return Math.round(69 + Math.log(freq / 440) * 12 / Math.LN2); - } - // Converts an ABC pitch (such as "^G,,") to a midi note number. - function pitchToMidi(pitch) { - var m = /^(\^+|_+|=|)([A-Ga-g])([,']*)$/.exec(pitch); - if (!m) { return null; } - var octave = m[3].replace(/,/g, '').length - m[3].replace(/'/g, '').length; - var semitone = - noteNum[m[2]] + accSym[m[1].charAt(0)] * m[1].length + 12 * octave; - return semitone + 60; // 60 = midi code middle "C". - } - // Converts a midi number to an ABC notation pitch. - function midiToPitch(midi) { - var index = ((midi - 72) % 12); - if (midi > 60 || index != 0) { index += 12; } - var octaves = Math.round((midi - index - 60) / 12), - result = noteName[index]; - while (octaves != 0) { - result += octaves > 0 ? "'" : ","; - octaves += octaves > 0 ? -1 : 1; - } - return result; - } - // Converts an ABC pitch to a frequency in Hz. - function pitchToFrequency(pitch) { - return midiToFrequency(pitchToMidi(pitch)); - } - // Converts an ABC duration to a number (e.g., "/3"->0.333 or "11/2"->1.5). - function durationToTime(duration) { - var m = /^(\d*)(?:\/(\d*))?$|^(\/+)$/.exec(duration), n, d, i = 0, ilen; - if (!m) return; - if (m[3]) return Math.pow(0.5, m[3].length); - d = (m[2] ? parseFloat(m[2]) : /\//.test(duration) ? 2 : 1); - // Handle mixed frations: - ilen = 0; - n = (m[1] ? parseFloat(m[1]) : 1); - if (m[2]) { - while (ilen + 1 < m[1].length && n > d) { - ilen += 1 - i = parseFloat(m[1].substring(0, ilen)) - n = parseFloat(m[1].substring(ilen)) - } - } - return i + (n / d); - } - - // The default sound is a square wave with a pretty quick decay to zero. - var defaultTimbre = Instrument.defaultTimbre = { - wave: 'square', // Oscillator type. - gain: 0.1, // Overall gain at maximum attack. - attack: 0.002, // Attack time at the beginning of a tone. - decay: 0.4, // Rate of exponential decay after attack. - decayfollow: 0, // Amount of decay shortening for higher notes. - sustain: 0, // Portion of gain to sustain indefinitely. - release: 0.1, // Release time after a tone is done. - cutoff: 0, // Low-pass filter cutoff frequency. - cutfollow: 0, // Cutoff adjustment, a multiple of oscillator freq. - resonance: 0, // Low-pass filter resonance. - detune: 0 // Detune factor for a second oscillator. - }; - - // Norrmalizes a timbre object by making a copy that has exactly - // the right set of timbre fields, defaulting when needed. - // A timbre can specify any of the fields of defaultTimbre; any - // unspecified fields are treated as they are set in defaultTimbre. - function makeTimbre(options, atop) { - if (!options) { - options = {}; - } - if (typeof(options) == 'string') { - // Abbreviation: name a wave to get a default timbre for that wave. - options = { wave: options }; + accent[letter] = m[1]; + return stripNatural(pitch); } - var result = {}, key, - wt = atop && atop.wavetable && atop.wavetable[options.wave]; - for (key in defaultTimbre) { - if (options.hasOwnProperty(key)) { - result[key] = options[key]; - } else if (wt && wt.defs && wt.defs.hasOwnProperty(key)) { - result[key] = wt.defs[key]; - } else{ - result[key] = defaultTimbre[key]; - } + if (accent.hasOwnProperty(letter)) { + // Accidentals from this measure apply to unaccented notes. + return stripNatural(accent[letter] + m[2] + m[3]); } - return result; - } - - var whiteNoiseBuf = null; - function getWhiteNoiseBuf() { - if (whiteNoiseBuf == null) { - var ac = getAudioTop().ac, - bufferSize = 2 * ac.sampleRate, - whiteNoiseBuf = ac.createBuffer(1, bufferSize, ac.sampleRate), - output = whiteNoiseBuf.getChannelData(0); - for (var i = 0; i < bufferSize; i++) { - output[i] = Math.random() * 2 - 1; - } + if (key.hasOwnProperty(letter)) { + // Key signatures apply by default. + return stripNatural(key[letter] + m[2] + m[3]); } - return whiteNoiseBuf; + return stripNatural(pitch); } - - // This utility function creates an oscillator at the given frequency - // and the given wavename. It supports lookups in a static wavetable, - // defined right below. - function makeOscillator(atop, wavename, freq) { - if (wavename == 'noise') { - var whiteNoise = atop.ac.createBufferSource(); - whiteNoise.buffer = getWhiteNoiseBuf(); - whiteNoise.loop = true; - return whiteNoise; - } - var wavetable = atop.wavetable, o = atop.ac.createOscillator(), - k, pwave, bwf, wf; - try { - if (wavetable.hasOwnProperty(wavename)) { - // Use a customized wavetable. - pwave = wavetable[wavename].wave; - if (wavetable[wavename].freq) { - bwf = 0; - // Look for a higher-frequency variant. - for (k in wavetable[wavename].freq) { - wf = Number(k); - if (freq > wf && wf > bwf) { - bwf = wf; - pwave = wavetable[wavename].freq[bwf]; - } - } - } - if (!o.setPeriodicWave && o.setWaveTable) { - // The old API name: Safari 7 still uses this. - o.setWaveTable(pwave); - } else { - // The new API name. - o.setPeriodicWave(pwave); - } - } else { - o.type = wavename; + // Converts an ABC duration to a number (e.g., "/3"->0.333 or "11/2"->1.5). + function durationToTime(duration) { + var m = /^(\d*)(?:\/(\d*))?$|^(\/+)$/.exec(duration), n, d, i = 0, ilen; + if (!m) return; + if (m[3]) return Math.pow(0.5, m[3].length); + d = (m[2] ? parseFloat(m[2]) : /\//.test(duration) ? 2 : 1); + // Handle mixed frations: + ilen = 0; + n = (m[1] ? parseFloat(m[1]) : 1); + if (m[2]) { + while (ilen + 1 < m[1].length && n > d) { + ilen += 1 + i = parseFloat(m[1].substring(0, ilen)) + n = parseFloat(m[1].substring(ilen)) } - } catch(e) { - if (window.console) { window.console.log(e); } - // If unrecognized, just use square. - // TODO: support "noise" or other wave shapes. - o.type = 'square'; } - o.frequency.value = freq; - return o; - } - - // Accepts either an ABC pitch or a midi number and converts to midi. - Instrument.pitchToMidi = function(n) { - if (typeof(n) == 'string') { return pitchToMidi(n); } - return n; - } - - // Accepts either an ABC pitch or a midi number and converts to ABC pitch. - Instrument.midiToPitch = function(n) { - if (typeof(n) == 'number') { return midiToPitch(n); } - return n; + return i + (n / d); } - - return Instrument; -})(); +} // wavetable is a table of names for nonstandard waveforms. // The table maps names to objects that have wave: and freq: @@ -5493,13 +5542,15 @@ function makeWavetable(ac) { // TODO: this approach attenuates low notes too much - // this should be fixed. defs: { wave: 'piano', gain: 0.5, - attack: 0.002, decay: 0.4, sustain: 0.005, release: 0.1, + attack: 0.002, decay: 0.25, sustain: 0.03, release: 0.1, decayfollow: 0.7, - cutoff: 800, cutfollow: 0.1, resonance: 1, detune: 1.001 } + cutoff: 800, cutfollow: 0.1, resonance: 1, detune: 0.9994 } } }); } +// End of musical.js copy. + ////////////////////////////////////////////////////////////////////////// // SYNC, REMOVE SUPPORT @@ -5661,7 +5712,7 @@ function globalhelp(obj) { helpwrite('This is an unassigned value.'); return helpok; } - if (obj === window) { + if (obj === global) { helpwrite('The global window object represents the browser window.'); return helpok; } @@ -5681,7 +5732,7 @@ function globalhelp(obj) { helplist = []; for (var name in helptable) { if (helptable[name].helptext && helptable[name].helptext.length && - (!(name in window) || typeof(window[name]) == 'function')) { + (!(name in global) || typeof(global[name]) == 'function')) { helplist.push(name); } } @@ -5712,6 +5763,7 @@ function canElementMoveInstantly(elem) { // moving at speed Infinity. var atime; return (elem && $.queue(elem).length == 0 && + (!elem.parentElement || !elem.parentElement.style.transform) && ((atime = animTime(elem)) === 0 || $.fx.speeds[atime] === 0)); } @@ -5895,6 +5947,9 @@ function wrapglobalcommand(name, helptext, fn, fnfilter) { cc.exit(); } if (early) { + if (early.result && early.result.constructor === jQuery && global_turtle) { + sync(global_turtle, early.result); + } return early.result; } }; @@ -5910,7 +5965,7 @@ function wrapwindowevent(name, helptext) { : null; if (forKey) { focusWindowIfFirst(); } if (fn == null && typeof(d) == 'function') { fn = d; d = null; } - $(window).on(name + '.turtleevent', null, d, !filter ? fn : function(e) { + $(global).on(name + '.turtleevent', null, d, !filter ? fn : function(e) { if (interrupted) return; if ($(e.target).closest(filter).length) { return; } return fn.apply(this, arguments); @@ -5919,7 +5974,7 @@ function wrapwindowevent(name, helptext) { } function windowhasturtleevent() { - var events = $._data(window, 'events'); + var events = $._data(global, 'events'); if (!events) return false; for (var type in events) { var entries = events[type]; @@ -5984,7 +6039,7 @@ function rtlt(cc, degrees, radius) { oldPos, oldTs.rot, oldTs.rot + (left ? -degrees : degrees), - newRadius * oldTs.sy, + newRadius * (state.oldscale ? oldTs.sy : 1), oldTransform); }); })(); @@ -6029,7 +6084,7 @@ function fdbk(cc, amount) { // CARTESIAN MOVEMENT FUNCTIONS ////////////////////////////////////////////////////////////////////////// -function move(cc, x, y) { +function slide(cc, x, y) { if ($.isArray(x)) { y = x[1]; x = x[0]; @@ -6134,11 +6189,60 @@ function makejump(move) { }); } +////////////////////////////////////////////////////////////////////////// +// SCALING FUNCTIONS +// Support for old-fashioned scaling and new. +////////////////////////////////////////////////////////////////////////// + +function elemOldScale(elem) { + var state = $.data(elem, 'turtleData'); + return state && (state.oldscale != null) ? state.oldscale : 1; +} + +function scaleCmd(cc, valx, valy) { + growImpl.call(this, true, cc, valx, valy); +} + +function grow(cc, valx, valy) { + growImpl.call(this, false, cc, valx, valy); +} + +function growImpl(oldscale, cc, valx, valy) { + if (valy === undefined) { valy = valx; } + // Disallow scaling to zero using this method. + if (!valx || !valy) { valx = valy = 1; } + var intick = insidetick; + this.plan(function(j, elem) { + if (oldscale) { + getTurtleData(elem).oldscale *= valy; + } + cc.appear(j); + if ($.isWindow(elem) || elem.nodeType === 9) { + cc.resolve(j); + return; + } + var c = $.map($.css(elem, 'turtleScale').split(' '), parseFloat); + if (c.length === 1) { c.push(c[0]); } + c[0] *= valx; + c[1] *= valy; + this.animate({turtleScale: $.map(c, cssNum).join(' ')}, + animTime(elem, intick), animEasing(elem), cc.resolver(j)); + }); + return this; +} + ////////////////////////////////////////////////////////////////////////// // DOT AND BOX FUNCTIONS // Support for animated drawing of dots and boxes. ////////////////////////////////////////////////////////////////////////// +function drawingScale(elem, oldscale) { + var totalParentTransform = totalTransform2x2(elem.parentElement), + simple = isone2x2(totalParentTransform), + scale = simple ? 1 : decomposeSVD(totalParentTransform)[1]; + return scale * elemOldScale(elem); +} + function animatedDotCommand(fillShape) { var intick = insidetick; return (function(cc, style, diameter) { @@ -6162,8 +6266,8 @@ function animatedDotCommand(fillShape) { ts = readTurtleTransform(elem, true), ps = parsePenStyle(style, 'fillStyle'), drawOnCanvas = getDrawOnCanvas(state), - // Scale by sx. (TODO: consider parent transforms.) - targetDiam = diameter * ts.sx, + sx = drawingScale(elem), + targetDiam = diameter * sx, animDiam = Math.max(0, targetDiam - 2), finalDiam = targetDiam + (ps.eraseMode ? 2 : 0), hasAlpha = /rgba|hsla/.test(ps.fillStyle); @@ -6320,6 +6424,39 @@ function drawArrowLine(c, w, x0, y0, x1, y1) { drawArrowHead(c, m); } +////////////////////////////////////////////////////////////////////////// +// VOICE SYNTHESIS +// Method for uttering words. +////////////////////////////////////////////////////////////////////////// +function utterSpeech(words, cb) { + var pollTimer = null; + function complete() { + if (pollTimer) { clearInterval(pollTimer); } + if (cb) { cb(); } + } + if (!global.speechSynthesis) { + console.log('No speech synthesis: ' + words); + complete(); + return; + } + try { + var msg = new global.SpeechSynthesisUtterance(words); + msg.addEventListener('end', complete); + msg.addEventListener('error', complete); + msg.lang = navigator.language || 'en-GB'; + global.speechSynthesis.speak(msg); + pollTimer = setInterval(function() { + // Chrome speech synthesis fails to deliver an 'end' event + // sometimes, so we also poll every 250ms. + if (global.speechSynthesis.pending || global.speechSynthesis.speaking) return; + complete(); + }, 250); + } catch (e) { + if (global.console) { global.console.log(e); } + complete(); + } +} + ////////////////////////////////////////////////////////////////////////// // TURTLE FUNCTIONS // Turtle methods to be registered as jquery instance methods. @@ -6342,9 +6479,9 @@ var turtlefn = { bk: wrapcommand('bk', 1, ["bk(pixels) Back. Moves in reverse by some pixels: " + "bk 100"], fdbk), - move: wrapcommand('move', 1, + slide: wrapcommand('slide', 1, ["move(x, y) Slides right x and forward y pixels without turning: " + - "move 50, 100"], move), + "slide 50, 100"], slide), movexy: wrapcommand('movexy', 1, ["movexy(x, y) Changes graphing coordinates by x and y: " + "movexy 50, 100"], movexy), @@ -6355,8 +6492,8 @@ var turtlefn = { "or an object on the page (see pagexy): " + "moveto lastmousemove"], moveto), jump: wrapcommand('jump', 1, - ["jump(x, y) Move without drawing (compare to move): " + - "jump 0, 50"], makejump(move)), + ["jump(x, y) Move without drawing (compare to slide): " + + "jump 0, 50"], makejump(slide)), jumpxy: wrapcommand('jumpxy', 1, ["jumpxy(x, y) Move without drawing (compare to movexy): " + "jump 0, 50"], makejump(movexy)), @@ -6411,7 +6548,7 @@ var turtlefn = { if (!nlocalxy) { nlocalxy = computePositionAsLocalOffset(elem, targetpos); } - dir = radiansToDegrees(Math.atan2(-nlocalxy[0], -nlocalxy[1])); + var dir = radiansToDegrees(Math.atan2(-nlocalxy[0], -nlocalxy[1])); ts = readTurtleTransform(elem, true); if (!(limit === null)) { r = convertToRadians(ts.rot); @@ -6450,6 +6587,52 @@ var turtlefn = { }); return this; }), + copy: wrapcommand('copy', 0, + ["copy() makes a new turtle that is a copy of this turtle."], + function copy(cc) { + var t2 = this.clone().insertAfter(this); + t2.hide(); + // t2.plan doesn't work here. + this.plan(function(j, elem) { + cc.appear(j); + + //copy over turtle data: + var olddata = getTurtleData(this); + var newdata = getTurtleData(t2); + for (var k in olddata) { newdata[k] = olddata[k]; } + + // copy over style attributes: + t2.attr('style', this.attr('style')); + + // copy each thing listed in css hooks: + for (var property in $.cssHooks) { + var value = this.css(property); + t2.css(property, value); + } + + // copy attributes, just in case: + var attrs = this.prop("attributes"); + for (var i in attrs) { + t2.attr(attrs[i].name, attrs[i].value); + } + + // copy the canvas: + var t2canvas = t2.canvas(); + var tcanvas = this.canvas(); + if (t2canvas && tcanvas) { + t2canvas.width = tcanvas.width; + t2canvas.height = tcanvas.height; + var newCanvasContext = t2canvas.getContext('2d'); + newCanvasContext.drawImage(tcanvas, 0, 0) + } + + t2.show(); + + cc.resolve(j); + }); // pass in our current clone, otherwise things apply to the wrong clone + sync(t2, this); + return t2; + }), pen: wrapcommand('pen', 1, ["pen(color, size) Selects a pen. " + "Chooses a color and/or size for the pen: " + @@ -6615,27 +6798,10 @@ var turtlefn = { }), scale: wrapcommand('scale', 1, ["scale(factor) Scales all motion up or down by a factor. " + - "To double all drawing: scale(2)"], - function scale(cc, valx, valy) { - if (valy === undefined) { valy = valx; } - // Disallow scaling to zero using this method. - if (!valx || !valy) { valx = valy = 1; } - var intick = insidetick; - this.plan(function(j, elem) { - cc.appear(j); - if ($.isWindow(elem) || elem.nodeType === 9) { - cc.resolve(j); - return; - } - var c = $.map($.css(elem, 'turtleScale').split(' '), parseFloat); - if (c.length === 1) { c.push(c[0]); } - c[0] *= valx; - c[1] *= valy; - this.animate({turtleScale: $.map(c, cssNum).join(' ')}, - animTime(elem, intick), animEasing(elem), cc.resolver(j)); - }); - return this; - }), + "To double all drawing: scale(2)"], scaleCmd), + grow: wrapcommand('grow', 1, + ["grow(factor) Changes the size of the element by a factor. " + + "To double the size: grow(2)"], grow), pause: wrapcommand('pause', 1, ["pause(seconds) Pauses some seconds before proceeding. " + "fd 100; pause 2.5; bk 100", @@ -6740,34 +6906,13 @@ var turtlefn = { this.plan(function(j, elem) { cc.appear(j); this.queue(function(next) { - var finished = false, - pollTimer = null, - complete = function() { - if (finished) return; - clearInterval(pollTimer); - finished = true; + utterSpeech(words, function() { cc.resolve(j); next(); - }; - try { - var msg = new SpeechSynthesisUtterance(words); - msg.addEventListener('end', complete); - msg.addEventListener('error', complete); - speechSynthesis.speak(msg); - pollTimer = setInterval(function() { - // Chrome speech synthesis fails to deliver an 'end' event - // sometimes, so we also poll every 250ms. - if (speechSynthesis.pending || speechSynthesis.speaking) return; - complete(); - }, 250); - } catch (e) { - console.log(e); - complete(); - } + }); }); }); return this; - }), play: wrapcommand('play', 1, ["play(notes) Play notes. Notes are specified in " + @@ -6924,10 +7069,7 @@ var turtlefn = { return this.plan(function(j, elem) { cc.appear(j); var state = getTurtleData(elem); - if (state.drawOnCanvas) { - sync(elem, state.drawOnCanvas); - } - if (!canvas || canvas === window) { + if (!canvas || canvas === global) { state.drawOnCanvas = null; } else if (canvas.jquery && $.isFunction(canvas.canvas)) { state.drawOnCanvas = canvas.canvas(); @@ -6966,13 +7108,13 @@ var turtlefn = { var intick = insidetick; return this.plan(function(j, elem) { cc.appear(j); - var applyStyles = {padding: 8}, + var applyStyles = {}, currentStyles = this.prop('style'); // For defaults, copy inline styles of the turtle itself except for // properties in the following list (these are the properties used to // make the turtle look like a turtle). - for (var j = 0; j < currentStyles.length; ++j) { - var styleProperty = currentStyles[j]; + for (var j2 = 0; j2 < currentStyles.length; ++j2) { + var styleProperty = currentStyles[j2]; if (/^(?:width|height|opacity|background-image|background-size)$/.test( styleProperty) || /transform/.test(styleProperty)) { continue; @@ -6991,6 +7133,10 @@ var turtlefn = { // Place the label on the screen using the figured styles. var out = prepareOutput(html, 'label').result.css(applyStyles) .addClass('turtlelabel').appendTo(getTurtleField()); + // If the output has a turtleinput, then forward mouse events. + if (out.hasClass('turtleinput') || out.find('.turtleinput').length) { + mouseSetupHook.apply(out.get(0)); + } if (styles && 'id' in styles) { out.attr('id', styles.id); } @@ -7034,7 +7180,7 @@ var turtlefn = { this.plan(function(j, elem) { cc.appear(j); if ($.isWindow(elem) || elem.nodeType === 9) { - window.location.reload(); + global.location.reload(); cc.resolve(j); return; } @@ -7175,7 +7321,7 @@ var turtlefn = { if (typeof val != 'object' || !$.isNumeric(val.width) || !$.isNumeric(val.height) || !($.isArray(val.data) || val.data instanceof Uint8ClampedArray || - val.data instanceof Unit8Array)) { + val.data instanceof Uint8Array)) { return; } var imdat = ctx.createImageData( @@ -7386,7 +7532,6 @@ var turtlefn = { callback.apply(this, arguments); } }); - sync = null; }), plan: wrapraw('plan', ["plan(fn) Runs fn in the animation queue. For planning logic: " + @@ -7442,6 +7587,33 @@ var turtlefn = { }) }; +////////////////////////////////////////////////////////////////////////// +// QUEUING SUPPORT +////////////////////////////////////////////////////////////////////////// + +function queueShowHideToggle() { + $.each(['toggle', 'show', 'hide'], function(i, name) { + + + var builtInFn = $.fn[name]; + // Change show/hide/toggle to queue their behavior by default. + // Since animating show/hide will call the zero-argument + // form synchronously at the end of animation, we avoid + // infinite recursion by examining jQuery's internal fxshow + // state and avoiding the recursion if the animation is calling + // show/hide. + $.fn[name] = function(speed, easing, callback) { + var a = arguments; + // TODO: file a bug in jQuery to allow solving this without _data. + if (!a.length && this.hasClass('turtle') && + (this.length > 1 || !$._data(this[0], 'fxshow'))) { + a = [0]; + } + builtInFn.apply(this, a); + } + }); +} + // If the queue for an image is empty, starts by queuing a wait-for-load. function queueWaitIfLoadingImg(img, qname) { if (!qname) qname = 'fx'; @@ -7456,6 +7628,10 @@ function queueWaitIfLoadingImg(img, qname) { } } +////////////////////////////////////////////////////////////////////////// +// HUNG LOOP DETECTION +////////////////////////////////////////////////////////////////////////// + var warning_shown = {}, loopCounter = 0, hungTimer = null, @@ -7483,7 +7659,7 @@ function checkForHungLoop(fname) { }, 0); return; } - // Timeout after which we interrupt the program: 6 seconds. + // Timeout after which we interrupt the program. if (now - hangStartTime > $.turtle.hangtime) { if (see.visible()) { see.html('Oops: program ' + @@ -7544,7 +7720,7 @@ function deprecate(map, oldname, newname) { __extends(map[oldname], map[newname]); } } -deprecate(turtlefn, 'slide', 'move'); +deprecate(turtlefn, 'move', 'slide'); deprecate(turtlefn, 'direct', 'plan'); deprecate(turtlefn, 'enclosedby', 'inside'); deprecate(turtlefn, 'bearing', 'direction'); @@ -7564,7 +7740,7 @@ $.fn.extend(turtlefn); // * Sets up a global "hatch" function to make a new turtle. ////////////////////////////////////////////////////////////////////////// -var turtleGIFUrl = "data:image/gif;base64,R0lGODlhKAAwAPIFAAAAAAFsOACSRTCuSICAgP///wAAAAAAACH5BAlkAAYAIf8LTkVUU0NBUEUyLjADAQAAACwAAAAAKAAwAAAD72i6zATEgBCAebHpzUnxhDAMAvhxKOoV3ziuZyo3RO26dTbvgXj/gsCO9ysOhENZz+gKJmcUkmA6PSKfSqrWieVtuU+KGNXbXofLEZgR/VHCgdua4isGz9mbmM6U7/94BmlyfUZ1fhqDhYuGgYqMkCOBgo+RfWsNlZZ3ewIpcZaIYaF6XaCkR6aokqqrk0qrqVinpK+fsbZkuK2ouRy0ob4bwJbCibthh6GYebGcY7/EsWqTbdNG1dd9jnXPyk2d38y0Z9Yub2yA6AvWPYk+zEnkv6xdCoPuw/X2gLqy9vJIGAN4b8pAgpQOIlzI8EkCACH5BAlkAAYALAAAAAAoADAAAAPuaLrMBMSAEIB5senNSfGEMAwC+HEo6hXfOK5nKjdE7bp1Nu+BeP+CwI73Kw6EQ1nP6AomZxSSYDo9Ip9KqtaJ5W25Xej3qqGYsdEfZbMcgZXtYpActzLMeLOP6c7f3nVNfEZ7TXSFg4lyZAYBio+LZYiQfHMbc3iTlG9ilGpdjp4ujESiI6RQpqegqkesqqhKrbEpoaa0KLaiuBy6nrxss6+3w7tomo+cDXmBnsoLza2nsb7SN2tl1nyozVOZTJhxysxnd9XYCrrAtT7KQaPruavBo2HQ8xrvffaN+GV5/JbE45fOG8Ek5Q4qXHgwAQA7" +var turtleGIFUrl = "data:image/gif;base64,R0lGODlhKAAwAPIFAAAAAAFsOACSRTCuSICAgP///wAAAAAAACH5BAlkAAYAIf8LTkVUU0NBUEUyLjADAQAAACwAAAAAKAAwAAAD72i6zATEgBCAebHpzUnxhDAMAvhxKOoV3ziuZyo3RO26dTbvgXj/gsCO9ysOhENZz+gKJmcUkmA6PSKfSqrWieVtuU+KGNXbXofLEZgR/VHCgdua4isGz9mbmM6U7/94BmlyfUZ1fhqDhYuGgYqMkCOBgo+RfWsNlZZ3ewIpcZaIYaF6XaCkR6aokqqrk0qrqVinpK+fsbZkuK2ouRy0ob4bwJbCibthh6GYebGcY7/EsWqTbdNG1dd9jnXPyk2d38y0Z9Yub2yA6AvWPYk+zEnkv6xdCoPuw/X2gLqy9vJIGAN4b8pAgpQOIlzI8EkCACH5BAlkAAYALAAAAAAoADAAAAPuaLrMBMSAEIB5senNSfGEMAwC+HEo6hXfOK5nKjdE7bp1Nu+BeP+CwI73Kw6EQ1nP6AomZxSSYDo9Ip9KqtaJ5W25Xej3qqGYsdEfZbMcgZXtYpActzLMeLOP6c7f3nVNfEZ7TXSFg4lyZAYBio+LZYiQfHMbc3iTlG9ilGpdjp4ujESiI6RQpqegqkesqqhKrbEpoaa0KLaiuBy6nrxss6+3w7tomo+cDXmBnsoLza2nsb7SN2tl1nyozVOZTJhxysxnd9XYCrrAtT7KQaPruavBo2HQ8xrvffaN+GV5/JbE45fOG8Ek5Q4qXHgwAQA7"; var eventfn = { click:1, dblclick:1, mouseup:1, mousedown:1, mousemove:1 }; @@ -7611,7 +7787,7 @@ var dollar_turtle_methods = { // Disable all input. $('.turtleinput').prop('disabled', true); // Detach all event handlers on the window. - $(window).off('.turtleevent'); + $(global).off('.turtleevent'); // Low-level detach all jQuery events $('*').not('#_testpanel *').map( function(i, e) { $._data(e, 'events', null) }); @@ -7694,6 +7870,20 @@ var dollar_turtle_methods = { function globalspeed(mps) { globaldefaultspeed(mps); }), + say: wrapraw('say', + ["say(words) Say something. Use English words." + + "say \"Let's go!\""], + function say(words) { + if (global_turtle) { + var sel = $(global_turtle); + sel.say.call(sel, words); + } else { + var cc = setupContinuation(null, 'say', arguments, 0); + cc.appear(null); + utterSpeech(words, function() { cc.resolve(null); }); + cc.exit(); + } + }), play: wrapraw('play', ["play(notes) Play notes. Notes are specified in " + "" + @@ -7725,7 +7915,7 @@ var dollar_turtle_methods = { sel.tone.apply(sel, arguments); } else { var instrument = getGlobalInstrument(); - instrument.play.apply(instrument, args); + instrument.play.apply(instrument); } }), silence: wrapraw('silence', @@ -7764,7 +7954,6 @@ var dollar_turtle_methods = { callback.apply(this, arguments); } }); - sync = null; }), load: wrapraw('load', ["load(url, cb) Loads data from the url and passes it to cb. " + @@ -7773,11 +7962,16 @@ var dollar_turtle_methods = { var val; $.ajax(apiUrl(url, 'load'), { async: !!cb, complete: function(xhr) { try { - val = JSON.parse(xhr.responseText); + val = xhr.responseObject = JSON.parse(xhr.responseText); if (typeof(val.data) == 'string' && typeof(val.file) == 'string') { val = val.data; + if (/\.json(?:$|\?|\#)/.test(url)) { + try { val = JSON.parse(val); } catch(e) {} + } } else if ($.isArray(val.list) && typeof(val.directory) == 'string') { val = val.list; + } else if (val.error) { + val = null; } } catch(e) { if (val == null && xhr && xhr.responseText) { @@ -7795,7 +7989,11 @@ var dollar_turtle_methods = { "save 'intro', 'pen gold, 20\\nfd 100\\n'"], function(url, data, cb) { if (!url) throw new Error('Missing url for save'); - var payload = { }, url = apiUrl(url, 'save'), key; + var payload = { }, key; + url = apiUrl(url, 'save'); + if (/\.json(?:$|\?|\#)/.test(url)) { + data = JSON.stringify(data, null, 2); + } if (typeof(data) == 'string' || typeof(data) == 'number') { payload.data = data; } else { @@ -7840,6 +8038,17 @@ var dollar_turtle_methods = { type: wrapglobalcommand('type', ["type(text) Types preformatted text like a typewriter. " + "type 'Hello!\n'"], plainTextPrint), + typebox: wrapglobalcommand('typebox', + ["typebox(clr) Draws a colored box as typewriter output. " + + "typebox red"], function(c, t) { + if (t == null && c != null && !isCSSColor(c)) { t = c; c = null; } + plainBoxPrint(c, t); + }), + typeline: wrapglobalcommand('typebox', + ["typeline() Same as type '\\n'. " + + "typeline()"], function(t) { + plainTextPrint((t || '') + '\n'); + }), write: wrapglobalcommand('write', ["write(html) Writes a line of text. Arbitrary HTML may be written: " + "write 'Hello, world!'"], doOutput, function() { @@ -7855,12 +8064,16 @@ var dollar_turtle_methods = { readnum: wrapglobalcommand('readnum', ["readnum(html, fn) Reads numeric input. Only numbers allowed: " + "readnum 'Amount?', (v) -> write 'Tip: ' + (0.15 * v)"], - doOutput, function readnum(a, b) { return prepareInput(a, b, 1); }), + doOutput, function readnum(a, b) { return prepareInput(a, b, 'number'); }), readstr: wrapglobalcommand('readstr', ["readstr(html, fn) Reads text input. Never " + "converts input to a number: " + "readstr 'Enter code', (v) -> write v.length + ' long'"], - doOutput, function readstr(a, b) { return prepareInput(a, b, -1); }), + doOutput, function readstr(a, b) { return prepareInput(a, b, 'text'); }), + listen: wrapglobalcommand('listen', + ["listen(html, fn) Reads voice input, if the browser supports it:" + + "listen 'Say something', (v) -> write v"], + doOutput, function readstr(a, b) { return prepareInput(a, b, 'voice'); }), menu: wrapglobalcommand('menu', ["menu(map) shows a menu of choices and calls a function " + "based on the user's choice: " + @@ -7977,41 +8190,129 @@ var dollar_turtle_methods = { ["abs(x) The absolute value of x. " + "see abs -5"], Math.abs), acos: wrapraw('acos', - ["acos(degreees) Trigonometric arccosine, in degrees. " + - "see acos 0.5"], - function acos(x) { return roundEpsilon(Math.acos(x) * 180 / Math.PI); } - ), + ["acos(x) Trigonometric arccosine, in radians. " + + "see acos 0.5"], Math.acos), asin: wrapraw('asin', - ["asin(degreees) Trigonometric arcsine, in degrees. " + - "see asin 0.5"], - function asin(x) { return roundEpsilon(Math.asin(x) * 180 / Math.PI); } - ), + ["asin(y) Trigonometric arcsine, in radians. " + + "see asin 0.5"], Math.asin), atan: wrapraw('atan', - ["atan(degreees) Trigonometric arctangent, in degrees. " + + ["atan(y, x = 1) Trigonometric arctangent, in radians. " + "see atan 0.5"], - function atan(x) { return roundEpsilon(Math.atan(x) * 180 / Math.PI); } + function atan(y, x) { return Math.atan2(y, (x == undefined) ? 1 : x); } ), - atan2: wrapraw('atan2', - ["atan2(degreees) Trigonometric two-argument arctangent, " + - "in degrees. see atan -1, 0"], - function atan2(x, y) { - return roundEpsilon(Math.atan2(x, y) * 180 / Math.PI); - }), cos: wrapraw('cos', - ["cos(degreees) Trigonometric cosine, in degrees. " + - "see cos 45"], - function cos(x) { return roundEpsilon(Math.cos((x % 360) * Math.PI / 180)); } - ), + ["cos(radians) Trigonometric cosine, in radians. " + + "see cos 0"], Math.cos), sin: wrapraw('sin', - ["sin(degreees) Trigonometric sine, in degrees. " + - "see sin 45"], - function sin(x) { return roundEpsilon(Math.sin((x % 360) * Math.PI / 180)); } - ), + ["sin(radians) Trigonometric sine, in radians. " + + "see sin 0"], Math.sin), tan: wrapraw('tan', - ["tan(degreees) Trigonometric tangent, in degrees. " + - "see tan 45"], - function tan(x) { return roundEpsilon(Math.tan((x % 360) * Math.PI / 180)); } - ), + ["tan(radians) Trigonometric tangent, in radians. " + + "see tan 0"], Math.tan), + + // For degree versions of trig functions, make sure we return exact + // results when possible. The set of values we have to consider is + // fortunately very limited. See "Rational Values of Trigonometric + // Functions." http://www.jstor.org/stable/2304540 + + acosd: wrapraw('acosd', + ["acosd(x) Trigonometric arccosine, in degrees. " + + "see acosd 0.5"], + function acosd(x) { + switch (x) { + case 1: return 0; + case .5: return 60; + case 0: return 90; + case -.5: return 120; + case -1: return 180; + } + return Math.acos(x) * 180 / Math.PI; + }), + asind: wrapraw('asind', + ["asind(x) Trigonometric arcsine, in degrees. " + + "see asind 0.5"], + function asind(x) { + switch (x) { + case 1: return 90; + case .5: return 30; + case 0: return 0; + case -.5: return -30; + case -1: return -90; + } + return Math.asin(x) * 180 / Math.PI; + }), + atand: wrapraw('atand', + ["atand(y, x = 1) Trigonometric arctangent, " + + "in degrees. see atand -1, 0/mark>"], + function atand(y, x) { + if (x == undefined) { x = 1; } + if (y == 0) { + return (x == 0) ? NaN : ((x > 0) ? 0 : 180); + } else if (x == 0) { + return (y > 0) ? Infinity : -Infinity; + } else if (Math.abs(y) == Math.abs(x)) { + return (y > 0) ? ((x > 0) ? 45 : 135) : + ((x > 0) ? -45 : -135); + } + return Math.atan2(y, x) * 180 / Math.PI; + }), + cosd: wrapraw('cosd', + ["cosd(degrees) Trigonometric cosine, in degrees. " + + "see cosd 45"], + function cosd(x) { + x = modulo(x, 360); + if (x % 30 === 0) { + switch ((x < 0) ? x + 360 : x) { + case 0: return 1; + case 60: return .5; + case 90: return 0; + case 120: return -.5; + case 180: return -1; + case 240: return -.5; + case 270: return 0; + case 300: return .5; + } + } + return Math.cos(x / 180 * Math.PI); + }), + sind: wrapraw('sind', + ["sind(degrees) Trigonometric sine, in degrees. " + + "see sind 45"], + function sind(x) { + x = modulo(x, 360); + if (x % 30 === 0) { + switch ((x < 0) ? x + 360 : x) { + case 0: return 0; + case 30: return .5; + case 90: return 1; + case 150: return .5; + case 180: return 0; + case 210: return -.5; + case 270: return -1; + case 330: return -.5; + } + } + return Math.sin(x / 180 * Math.PI); + }), + tand: wrapraw('tand', + ["tand(degrees) Trigonometric tangent, in degrees. " + + "see tand 45"], + function tand(x) { + x = modulo(x, 360); + if (x % 45 === 0) { + switch ((x < 0) ? x + 360 : x) { + case 0: return 0; + case 45: return 1; + case 90: return Infinity; + case 135: return -1; + case 180: return 0; + case 225: return 1; + case 270: return -Infinity; + case 315: return -1 + } + } + return Math.tan(x / 180 * Math.PI); + }), ceil: wrapraw('ceil', ["ceil(x) Round up. " + "see ceil 1.9"], Math.ceil), @@ -8069,7 +8370,7 @@ var dollar_turtle_methods = { ["loadscript(url, callback) Loads Javascript or Coffeescript from " + "the given URL, calling callback when done."], function loadscript(url, callback) { - if (window.CoffeeScript && /\.(?:coffee|cs)$/.test(url)) { + if (global.CoffeeScript && /\.(?:coffee|cs)$/.test(url)) { CoffeeScript.load(url, callback); } else { $.getScript(url, callback); @@ -8116,6 +8417,8 @@ function pollSendRecv(name) { deprecate(dollar_turtle_methods, 'defaultspeed', 'speed'); +dollar_turtle_methods.save.loginCookie = loginCookie; + var helpok = {}; var colors = [ @@ -8184,14 +8487,12 @@ var colors = [ $.turtle = function turtle(id, options) { var exportedsee = false; - if (!arguments.length) { - id = 'turtle'; - } if (arguments.length == 1 && typeof(id) == 'object' && id && !id.hasOwnProperty('length')) { options = id; id = 'turtle'; } + id = id || 'turtle'; options = options || {}; if ('turtle' in options) { id = options.turtle; @@ -8209,34 +8510,40 @@ $.turtle = function turtle(id, options) { if (!globalDrawing.ctx && ('subpixel' in options)) { globalDrawing.subpixel = parseInt(options.subpixel); } - // Set up hung-browser timeout, default 10 seconds. + // Set up hung-browser timeout, default 20 seconds. $.turtle.hangtime = ('hangtime' in options) ? - parseFloat(options.hangtime) : 10000; + parseFloat(options.hangtime) : 20000; // Set up global events. - if (!('events' in options) || options.events) { + if (options.events !== false) { turtleevents(options.eventprefix); } - if (!('pressed' in options) || options.pressed) { + if (options.pressed !== false) { addKeyEventHooks(); pressedKey.enable(true); } // Set up global log function. - if (!('see' in options) || options.see) { + if (options.see !== false) { exportsee(); exportedsee = true; - if (window.addEventListener) { - window.addEventListener('error', see); + if (global.addEventListener) { + global.addEventListener('error', see); } else { - window.onerror = see; + global.onerror = see; } // Set up an alias. - window.log = see; + global.debug = see; + // 'debug' should be used now instead of log + deprecate(global, 'log', 'debug'); } + if (options.queuehide !== false) { + queueShowHideToggle(); + } + // Copy $.turtle.* functions into global namespace. - if (!('functions' in options) || options.functions) { - window.printpage = window.print; - $.extend(window, dollar_turtle_methods); + if (options.functions !== false) { + global.printpage = global.print; + $.extend(global, dollar_turtle_methods); } // Set default turtle speed globaldefaultspeed(('defaultspeed' in options) ? @@ -8261,11 +8568,11 @@ $.turtle = function turtle(id, options) { } if (selector && !selector.length) { selector = null; } // Globalize selected jQuery methods of a singleton turtle. - if (selector && selector.length === 1 && - (!('global' in options) || options.global)) { + if (selector && selector.length === 1 && (options.global !== false)) { var extraturtlefn = { css:1, fadeIn:1, fadeOut:1, fadeTo:1, fadeToggle:1, - animate:1, toggle:1, finish:1, promise:1, direct:1 }; + animate:1, toggle:1, finish:1, promise:1, direct:1, + show:1, hide:1 }; var globalfn = $.extend({}, turtlefn, extraturtlefn); global_turtle_methods.push.apply(global_turtle_methods, globalizeMethods(selector, globalfn)); @@ -8274,14 +8581,14 @@ $.turtle = function turtle(id, options) { selector.css({zIndex: 1}); } // Set up global objects by id. - if (!('ids' in options) || options.ids) { + if (options.ids !== false) { turtleids(options.idprefix); if (selector && id) { - window[id] = selector; + global[id] = selector; } } // Set up test console. - if (!('panel' in options) || options.panel) { + if (options.panel !== false) { var seeopt = { title: 'test panel (type help for help)', abbreviate: [undefined, helpok], @@ -8295,24 +8602,20 @@ $.turtle = function turtle(id, options) { seeopt.height = options.panelheight; } see.init(seeopt); - if (wrotebody) { - /* - see.html('Turtle script should be inside body ' + - '- wrote a <body>'); - */ - } // Return an eval loop hook string if 'see' is exported. if (exportedsee) { - if (window.CoffeeScript) { + if (global.CoffeeScript) { return "see.init(eval(see.cs))"; } else { return see.here; } } } + return $('#' + id); }; $.extend($.turtle, dollar_turtle_methods); +$.turtle.colors = colors; function seehelphook(text, result) { // Also, check the command to look for (non-CoffeeScript) help requests. @@ -8346,9 +8649,9 @@ function copyhelp(method, fname, extrahelp, globalfn) { function globalizeMethods(thisobj, fnames) { var replaced = []; for (var fname in fnames) { - if (fnames.hasOwnProperty(fname) && !(fname in window)) { + if (fnames.hasOwnProperty(fname) && !(fname in global)) { replaced.push(fname); - window[fname] = (function(fname) { + global[fname] = (function(fname) { var method = thisobj[fname], target = thisobj; return copyhelp(method, fname, extrahelp, (function globalized() { /* Use parentheses to call a function */ @@ -8362,7 +8665,7 @@ function globalizeMethods(thisobj, fnames) { function clearGlobalTurtle() { global_turtle = null; for (var j = 0; j < global_turtle_methods.length; ++j) { - delete window[global_turtle_methods[j]]; + delete global[global_turtle_methods[j]]; } global_turtle_methods.length = 0; } @@ -8377,10 +8680,10 @@ $.cleanData = function(elems) { state.stream.stop(); } // Undefine global variablelem. - if (elem.id && window[elem.id] && window[elem.id].jquery && - window[elem.id].length === 1 && - window[elem.id][0] === elem) { - delete window[elem.id]; + if (elem.id && global[elem.id] && global[elem.id].jquery && + global[elem.id].length === 1 && + global[elem.id][0] === elem) { + delete global[elem.id]; } // Clear global turtlelem. if (elem === global_turtle) { @@ -8672,7 +8975,9 @@ function createRectangleShape(width, height, subpixels) { subpixels = 1; } return (function(color) { - var c = getOffscreenCanvas(width, height); + var c = document.createElement('canvas'); + c.width = width; + c.height = height; var ctx = c.getContext('2d'); if (!color) { color = "rgba(128,128,128,0.125)"; @@ -8694,7 +8999,7 @@ function createRectangleShape(width, height, subpixels) { css.imageRendering = 'pixelated'; } return { - url: c.toDataURL(), + img: c, css: css }; }); @@ -8739,7 +9044,7 @@ function nameToImg(name, defaultshape) { // Deal with unquoted "tan" and "dot". name = name.helpname || name.name; } - if (name.constructor === $) { + if (name.constructor === jQuery) { // Unwrap jquery objects. if (!name.length) { return null; } name = name.get(0); @@ -8770,14 +9075,18 @@ function nameToImg(name, defaultshape) { if (shape) { return shape(color); } + // Default to '/img/' URLs if it doesn't match a well-known name. + if (!/\//.test(name)) { + name = imgUrl(name); + } // Parse URLs. if (/\//.test(name)) { var hostname = absoluteUrlObject(name).hostname; // Use proxy to load image if the image is offdomain but the page is on // a pencil host (with a proxy). - if (!isPencilHost(hostname) && isPencilHost(window.location.hostname)) { - name = window.location.protocol + '//' + - window.location.host + '/proxy/' + absoluteUrl(name); + if (!isPencilHost(hostname) && isPencilHost(global.location.hostname)) { + name = global.location.protocol + '//' + + global.location.host + '/proxy/' + absoluteUrl(name); } return { url: name, @@ -8813,11 +9122,11 @@ function hatchone(name, container, defaultshape) { // Create an image element with the requested name. var result; - if (img) { + if (isTag) { + result = $(name); + } else if (img) { result = $('

.
+function getTrailingPre() {
+  var pre = document.body.lastChild;
+  if (!pre || pre.tagName != 'PRE') {
+    pre = document.createElement('pre');
+    document.body.appendChild(pre);
+  }
+  return pre;
+}
+
 function plainTextPrint() {
   var args = arguments;
   autoScrollAfter(function() {
-    var pre = document.body.lastChild;
-    if (!pre || pre.tagName != 'PRE') {
-      pre = document.createElement('pre');
-      document.body.appendChild(pre);
-    }
+    var pre = getTrailingPre();
     for (var j = 0; j < args.length; j++) {
       pre.appendChild(document.createTextNode(String(args[j])));
     }
   });
 }
 
+function plainBoxPrint(clr, text) {
+  var elem = $("").css({
+    display: 'inline-block',
+    verticalAlign: 'top',
+    textAlign: 'center',
+    height: '1.2em',
+    width: '1.2em',
+    maxWidth: '1.2em',
+    overflow: 'hidden'
+  }).appendTo(getTrailingPre()), finish = function() {
+    if (clr != null) { elem.css({background: clr}); }
+    if (text != null) { elem.text(text); }
+  };
+  if (!global_turtle) {
+    finish();
+  } else {
+    var turtle = $(global_turtle);
+    moveto.call(turtle, null, elem);
+    turtle.eq(0).plan(finish);
+  }
+}
+
 // Put this output on the screen.  Called some time after prepareOutput
 // if the turtle is animating.
 function doOutput() {
@@ -9144,6 +9482,8 @@ function prepareOutput(html, tag) {
   if (html === undefined || html === null) {
     // Make empty line when no arguments.
     return {result: $(prefix + '
' + suffix)};
+  } else if (html.jquery || (html instanceof Element && (html = $(html)))) {
+    return {result: html};
   } else {
     var wrapped = false, result = null;
     html = '' + html;
@@ -9321,18 +9661,25 @@ function prepareButton(name, callback) {
 // for creating an input box with a label, for one-shot input
 //////////////////////////////////////////////////////////////////////////
 
+var microphoneSvg = "data:image/svg+xml,"
+
 // Simplify $('body').append('' + label) and onchange hookup.
-function prepareInput(name, callback, numeric) {
+// Type can be 'auto', 'number', 'text', or 'voice' for slightly
+// different interfaces.
+function prepareInput(name, callback, type) {
   if ($.isFunction(name) && !callback) {
     callback = name;
     name = null;
   }
+  if (!type) { type = 'auto'; }
   name = $.isNumeric(name) || name ? name : '⇒';
   var textbox = $('').css({margin:0, padding:0}),
+      button = $('').css({marginLeft:4}),
       label = $('' + name + ' ' +
-        '').append(textbox),
+        '').append(textbox).append(button),
       debounce = null,
-      lastseen = textbox.val();
+      lastseen = textbox.val(),
+      recognition = null;
   function dodebounce() {
     if (!debounce) {
       debounce = setTimeout(function() { debounce = null; }, 1000);
@@ -9345,16 +9692,17 @@ function prepareInput(name, callback, numeric) {
     dodebounce();
     lastseen = val;
     textbox.remove();
+    button.remove();
     label.append(val).css({display: 'table'});
-    if (numeric > 0 || (
-      numeric >= 0 && $.isNumeric(val) && ('' + parseFloat(val) == val))) {
+    if (type == 'number' || (type == 'auto' &&
+      $.isNumeric(val) && ('' + parseFloat(val) == val))) {
       val = parseFloat(val);
     }
     label.prop('value', val);
     if (callback) { setTimeout(function() {callback.call(label, val); }, 0); }
   }
   function validate() {
-    if (numeric <= 0) return true;
+    if (type != 'numeric') return true;
     var val = textbox.val(),
         nval = val.replace(/[^0-9\.]/g, '');
     if (val != nval || !$.isNumeric(nval)) {
@@ -9368,19 +9716,23 @@ function prepareInput(name, callback, numeric) {
       if (!validate()) { return false; }
       newval();
     }
-    if (numeric > 0 && (e.which >= 32 && e.which <= 127) &&
+    if (type == 'voice' && recognition) {
+      recognition.abort();
+      recognition = null;
+    }
+    if (type == 'numeric' && (e.which >= 32 && e.which <= 127) &&
         (e.which < '0'.charCodeAt(0) || e.which > '9'.charCodeAt(0)) &&
         (e.which != '.'.charCodeAt(0) || ~textbox.val().indexOf('.'))) {
       return false;
     }
   }
   textbox.on('keypress keydown', key);
-  textbox.on('change', newval);
+  button.on('click', newval);
   return {
     result: label,
     setup: function() {
       dodebounce();
-      if (numeric < 0) {
+      if (type == 'text' || type == 'voice') {
         // Widen a "readstr" textbox to make it fill the line.
         var availwidth = label.parent().width(),
             freewidth = availwidth + label.offset().left - textbox.offset().left,
@@ -9389,6 +9741,48 @@ function prepareInput(name, callback, numeric) {
             marginwidth = textbox.outerWidth(true) - textbox.width();
         textbox.width(desiredwidth - marginwidth);
       }
+      if (type == 'number') {
+        textbox.attr('type', 'number');
+      }
+      if (type == 'voice') {
+        button.css({display: 'none'});
+        var SR = global.SpeechRecognition || global.webkitSpeechRecognition;
+        if ('function' == typeof(SR)) {
+          try {
+            recognition = new SR();
+            recognition.continuous = false;
+            recognition.interimResults = true;
+            textbox.css({backgroundColor: 'lightyellow',
+              color: 'gray',
+              backgroundImage: "url(" + microphoneSvg + ")",
+              backgroundRepeat: 'no-repeat',
+              backgroundPosition: 'center'});
+            recognition.onspeechstart = function() {
+              textbox.css({background: 'lightgreen'});
+            };
+            recognition.onend = function() {
+              textbox.css({color: '', backgroundColor: '', backgroundImage: '',
+                backgroundRepeat: '', backgroundPosition: ''});
+              textbox.val(lastseen);
+              newval();
+            };
+            recognition.onresult = function(event) {
+              var text = event.results[0][0].transcript;
+              var confidence = event.results[0][0].confidence;
+              var shade = 128 - 128 * confidence;
+              if (event.results[0].isFinal) {
+                shade = 0;
+                lastseen = text;
+              }
+              textbox.css({color: componentColor('rgb', shade, shade, shade)});
+              textbox.val(text);
+            };
+            recognition.start();
+          } catch (e) {
+            console.log(e);
+          }
+        }
+      }
       // Focus, but don't cause autoscroll to occur due to focus.
       undoScrollAfter(function() { textbox.focus(); });
     }
@@ -9486,58 +9880,57 @@ function componentColor(t, args) {
   return t + '(' + Array.prototype.join.call(args, ',') + ')';
 }
 
-function autoArgs(arguments, start, map) {
+function autoArgs(args, start, map) {
   var j = 0;
   var taken = [];
   var result = {};
   for (var key in map) {
     var pattern = map[key];
-    for (j = start; j < arguments.length; ++j) {
+    for (j = start; j < args.length; ++j) {
       if (~taken.indexOf(j)) continue;
       if (pattern == '*') {
         break;
-      } else if (pattern instanceof RegExp && pattern.test(arguments[j])) {
+      } else if (pattern instanceof RegExp && pattern.test(args[j])) {
         break;
-      } else if (pattern instanceof Function && pattern(arguments[j])) {
+      } else if (pattern instanceof Function && pattern(args[j])) {
         break;
-      } else if (pattern == typeof arguments[j]) {
+      } else if (pattern == typeof args[j]) {
         break;
       }
     }
-    if (j < arguments.length) {
+    if (j < args.length) {
       taken.push(j);
-      result[key] = arguments[j];
+      result[key] = args[j];
     }
   }
-  if (taken.length + start < arguments.length) {
+  if (taken.length + start < args.length) {
     var extra = [];
-    for (j = start; j < arguments.length; ++j) {
+    for (j = start; j < args.length; ++j) {
       if (~taken.indexOf(j)) continue;
-      extra.push(arguments[j]);
+      extra.push(args[j]);
     }
     result.extra = extra;
   }
   return result;
 }
 
+
 //////////////////////////////////////////////////////////////////////////
 // DEBUGGING SUPPORT
 //////////////////////////////////////////////////////////////////////////
 var debug = {
   init: function initdebug() {
+    if (this.ide) return;  // Don't re-initialize debug.
     try {
-      if (parent && parent.ide) {
+      if (parent && parent.ide && parent.ide.bindframe &&
+          parent.ide.bindframe(global, parent)) {
         this.ide = parent.ide;
-        this.ide.bindframe(window);
         this.attached = true;
       }
-    } catch(e) {
-      this.ide = null;
-      this.attached = false;
-    }
+    } catch(e) { }
     if (this.attached) {
-      if (window.addEventListener) {
-        window.addEventListener('error', function(event) {
+      if (global.addEventListener) {
+        global.addEventListener('error', function(event) {
           // An error event will highlight the error line.
           debug.reportEvent('error', [event]);
         });
@@ -9564,7 +9957,7 @@ debug.init();
 // X Y coordinate showing support
 //////////////////////////////////////////////////////////////////////////
 (function() {
-  if (!debug.ide || (debug.ide.getOptions && !debug.ide.getOptions().panel)) {
+  if (!debug.ide) {
     // Only show the X-Y tip if inside a debugging IDE.
     return;
   }
@@ -9591,7 +9984,7 @@ debug.init();
   }
   var linestart = null, linecanvas = null, lineend = null,
       xa = 0, ya = 0, xb = 0, yb = 0, xt, yt, dr, ar;
-  $(window).on('mousedown mouseup mousemove keydown', function(e) {
+  $(global).on('mousedown mouseup mousemove keydown', function(e) {
     if (e.type == 'keydown') {
       if (e.which < 27) return;
       if (linecanvas) linecanvas.remove();
@@ -9632,7 +10025,7 @@ debug.init();
           c = cnv.getContext('2d'),
           relative = false,
           p = lineend || e,
-          s, html, dx, dy, dd, dir, ang;
+          html, dx, dy, dd, dir, ang;
       if (linestart && 'function' == typeof(linestart.pagexy)) {
         var xy = linestart.getxy(), s = linestart.pagexy();
         s.x = xy[0];
@@ -9661,7 +10054,7 @@ debug.init();
       ang = Math.atan2(dx, dy) / Math.PI * 180;
       if (linestart) {
         c.save();
-        c.clearRect(xa - 10, ya - 10, xb + 10, yb + 10);
+        c.clearRect(xa - 10, ya - 10, xb - xa + 20, yb - ya + 20);
         xa = xb = s.pageX;
         ya = yb = s.pageY;
         // Draw a dot
@@ -9718,16 +10111,16 @@ debug.init();
       var pos = { left: '', top: '', right: '', bottom: '' };
       if (p.pageX + 5 < s.pageX) {
         pos.left = Math.max(
-            p.pageX - $(window).scrollLeft() - location.outerWidth() - 5, 2);
+            p.pageX - $(global).scrollLeft() - location.outerWidth() - 5, 2);
       } else {
-        pos.left = Math.min(p.pageX - $(window).scrollLeft() + 5,
+        pos.left = Math.min(p.pageX - $(global).scrollLeft() + 5,
             $(document).width() - location.outerWidth() - 2);
       }
       if (p.pageY + 5 < s.pageY) {
         pos.top = Math.max(
-            p.pageY - $(window).scrollTop() - location.outerHeight() - 5, 2);
+            p.pageY - $(global).scrollTop() - location.outerHeight() - 5, 2);
       } else {
-        pos.top = Math.min(p.pageY - $(window).scrollTop() + 5,
+        pos.top = Math.min(p.pageY - $(global).scrollTop() + 5,
             $(document).height() - location.outerHeight() - 2);
       }
       location.css(pos);
@@ -9769,14 +10162,15 @@ var linestyle = 'position:relative;display:block;font-family:monospace;' +
 var logdepth = 5;
 var autoscroll = false;
 var logelement = 'body';
-var panel = false;
+var panel = 'auto';
 try {
   // show panel by default if framed inside a an ide,
   // and if the screen is big enough (i.e., omit mobile clients).
-  panel = (window.self !== window.top &&
-           screen.width >= 800 && screen.height >= 600 &&
-           parent && parent.ide && parent.ide.getOptions().panel);
+  if (global.self !== global.top &&
+      screen.width >= 800 && screen.height >= 600 &&
+      parent && parent.ide) { panel = parent.ide.getOptions().panel; }
 } catch(e) {}
+var consolelog = panel;
 var see;  // defined below.
 var paneltitle = '';
 var logconsole = null;
@@ -9784,10 +10178,10 @@ var uselocalstorage = '_loghistory';
 var panelheight = 50;
 var currentscope = '';
 var scopes = {
-  '':  { e: window.eval, t: window },
-  top: { e: window.eval, t: window }
+  '':  { e: global.eval, t: global },
+  top: { e: global.eval, t: global }
 };
-var coffeescript = window.CoffeeScript;
+var coffeescript = global.CoffeeScript;
 var seejs = '(function(){return eval(arguments[0]);})';
 
 function init(options) {
@@ -9815,13 +10209,17 @@ function init(options) {
   if ('coffee' in options) { coffeescript = options.coffee; }
   if ('abbreviate' in options) { abbreviate = options.abbreviate; }
   if ('consolehook' in options) { consolehook = options.consolehook; }
+  if ('consolelog' in options) { consolelog = options.consolelog; }
   if ('noconflict' in options) { noconflict(options.noconflict); }
   if (panel) {
     // panel overrides element and autoscroll.
     logelement = '#_testlog';
     autoscroll = '#_testscroll';
-    pulljQuery(tryinitpanel);
+    if (panel === true) {
+      startinitpanel();
+    }
   }
+  if (consolelog === true) { initconsolelog(); }
   return scope();
 }
 
@@ -9845,6 +10243,7 @@ function seeeval(scope, code) {
     if (scopes[scope].e) { ef = scopes[scope].e; }
     if (scopes[scope].t) { et = scopes[scope].t; }
   }
+  debug.reportEvent("seeeval", [scope, code]);
   return ef.call(et, code);
 }
 
@@ -9854,7 +10253,7 @@ var initialvardecl = new RegExp(
 
 function barecs(s) {
   // Compile coffeescript in bare mode.
-  var compiler = coffeescript || window.CoffeeScript;
+  var compiler = coffeescript || global.CoffeeScript;
   var compiled = compiler.compile(s, {bare:1});
   if (compiled) {
     // Further strip top-level var decls out of the coffeescript so
@@ -9881,22 +10280,22 @@ function exportsee() {
   see.js = seejs;
   see.cs = '(function(){return eval(' + seepkg + '.barecs(arguments[0]));})';
   see.version = version;
-  window[seepkg] = see;
+  global[seepkg] = see;
 }
 
 function noteoldvalue(name) {
   return {
     name: name,
-    has: window.hasOwnProperty(name),
-    value: window[name]
+    has: global.hasOwnProperty(name),
+    value: global[name]
   };
 }
 
 function restoreoldvalue(old) {
   if (!old.has) {
-    delete window[old.name];
+    delete global[old.name];
   } else {
-    window[old.name] = old.value;
+    global[old.name] = old.value;
   }
 }
 
@@ -9960,7 +10359,7 @@ var queue = [];
 
 see = function see() {
   if (logconsole && typeof(logconsole.log) == 'function') {
-    logconsole.log.apply(window.console, arguments);
+    logconsole.log.apply(global.console, arguments);
   }
   var args = Array.prototype.slice.call(arguments);
   queue.push('');
@@ -10014,7 +10413,8 @@ function isprimitive(vt) {
 }
 
 function isdom(obj) {
-  return (obj.nodeType && obj.nodeName && typeof(obj.cloneNode) == 'function');
+  return (obj && obj.nodeType && obj.nodeName &&
+          typeof(obj.cloneNode) == 'function');
 }
 
 function midtruncate(s, maxlen) {
@@ -10309,12 +10709,12 @@ function expand(prefix, obj, depth, output) {
   }
 }
 function initlogcss() {
-  if (!addedcss && !window.document.getElementById('_logcss')) {
-    var style = window.document.createElement('style');
+  if (!addedcss && !global.document.getElementById('_logcss')) {
+    var style = global.document.createElement('style');
     style.id = '_logcss';
     style.innerHTML = (linestyle ? 'samp._log{' +
         linestyle + '}' : '') + logcss;
-    window.document.head.appendChild(style);
+    global.document.head.appendChild(style);
     addedcss = true;
   }
 }
@@ -10352,7 +10752,6 @@ function aselement(s, def) {
     default:
       return s;
   }
-  return null;
 }
 function stickscroll() {
   var stick = false, a = aselement(autoscroll, null);
@@ -10368,10 +10767,10 @@ function stickscroll() {
   }
 }
 function flushqueue() {
-  var elt = aselement(logelement, null);
+  var elt = aselement(logelement, null), child;
   if (elt && elt.appendChild && queue.length) {
     initlogcss();
-    var temp = window.document.createElement('samp');
+    var temp = global.document.createElement('samp');
     temp.innerHTML = queue.join('');
     queue.length = 0;
     var complete = stickscroll();
@@ -10381,7 +10780,10 @@ function flushqueue() {
     complete();
   }
   if (!retrying && queue.length) {
-    retrying = setTimeout(function() { timer = null; flushqueue(); }, 100);
+    if (panel == 'auto') {
+      startinitpanel();
+    }
+    retrying = setTimeout(function() { retrying = null; flushqueue(); }, 100);
   } else if (retrying && !queue.length) {
     clearTimeout(retrying);
     retrying = null;
@@ -10392,6 +10794,7 @@ function flushqueue() {
 // TEST PANEL SUPPORT
 // ---------------------------------------------------------------------
 var addedpanel = false;
+var initpanelstarted = false;
 var inittesttimer = null;
 var abbreviate = [{}.undefined];
 var consolehook = null;
@@ -10416,7 +10819,7 @@ function promptcaret(color) {
   return '';
 }
 function getSelectedText(){
-    if(window.getSelection) { return window.getSelection().toString(); }
+    if(global.getSelection) { return global.getSelection().toString(); }
     else if(document.getSelection) { return document.getSelection(); }
     else if(document.selection) {
         return document.selection.createRange().text; }
@@ -10432,7 +10835,7 @@ function readlocalstorage() {
   }
   var state = { height: panelheight, history: [] }, result;
   try {
-    result = window.JSON.parse(window.localStorage[uselocalstorage]);
+    result = global.JSON.parse(global.localStorage[uselocalstorage]);
   } catch(e) {
     result = noLocalStorage || {};
   }
@@ -10463,14 +10866,37 @@ function updatelocalstorage(state) {
   }
   if (changed) {
     try {
-      window.localStorage[uselocalstorage] = window.JSON.stringify(stored);
+      global.localStorage[uselocalstorage] = global.JSON.stringify(stored);
     } catch(e) {
       noLocalStorage = stored;
     }
   }
 }
 function wheight() {
-  return window.innerHeight || $(window).height();
+  return global.innerHeight || $(global).height();
+}
+function initconsolelog() {
+  try {
+    if (consolelog && global.console && !global.console._log &&
+        'function' == typeof global.console.log) {
+      var _log = global.console._log = global.console.log;
+      global.console.log = function log() {
+        _log.apply(this, arguments);
+        see.apply(this, arguments);
+      }
+      var _debug = global.console._debug = global.console.debug;
+      global.console.debug = function debug() {
+        _debug.apply(this, arguments);
+        see.apply(this, arguments);
+      }
+    }
+  } catch(e) { }
+}
+function startinitpanel() {
+  if (!initpanelstarted) {
+    initpanelstarted = true;
+    pulljQuery(tryinitpanel);
+  }
 }
 function tryinitpanel() {
   if (addedpanel) {
@@ -10483,7 +10909,8 @@ function tryinitpanel() {
     }
     $('#_testpanel').show();
   } else {
-    if (!window.document.getElementById('_testlog') && window.document.body) {
+    if (!global.document.getElementById('_testlog') && global.document.body) {
+      initconsolelog();
       initlogcss();
       var state = readlocalstorage();
       var titlehtml = (paneltitle ? formattitle(paneltitle) : '');
@@ -10613,7 +11040,7 @@ function tryinitpanel() {
           }
           if (e.type == 'mouseup' || e.type == 'blur' ||
               e.type == 'mousemove' && e.which != dragwhich) {
-            $(window).off('mousemove mouseup blur', dragfunc);
+            $(global).off('mousemove mouseup blur', dragfunc);
             if (document.releaseCapture) { document.releaseCapture(); }
             if ($('#_testpanel').height() != state.height) {
               state.height = $('#_testpanel').height();
@@ -10621,7 +11048,7 @@ function tryinitpanel() {
             }
           }
         };
-        $(window).on('mousemove mouseup blur', dragfunc);
+        $(global).on('mousemove mouseup blur', dragfunc);
         return false;
       });
       $('#_testpanel').on('mouseup', function(e) {
@@ -10648,14 +11075,14 @@ function transparentHull(image, threshold) {
   if (!threshold) threshold = 0;
   c.width = image.width;
   c.height = image.height;
-  ctx = c.getContext('2d');
+  var ctx = c.getContext('2d');
   ctx.drawImage(image, 0, 0);
   return transparentCanvasHull(c, threshold);
 }
 
 function transparentCanvasHull(canvas, threshold) {
   var ctx = canvas.getContext('2d');
-  data = ctx.getImageData(0, 0, canvas.width, canvas.height).data;
+  var data = ctx.getImageData(0, 0, canvas.width, canvas.height).data;
   var hull = [];
   var intthresh = 256 * threshold;
   var first, last, prevfirst = Infinity, prevlast = -1;
@@ -10687,7 +11114,7 @@ function transparentCanvasHull(canvas, threshold) {
 function eraseOutsideHull(canvas, hull) {
   var ctx = canvas.getContext('2d'),
       w = canvas.width,
-      h = canvas.height
+      h = canvas.height,
       j = 0;
   ctx.save();
   // Erase everything outside clipping region.
@@ -10716,4 +11143,4 @@ function scalePolygon(poly, sx, sy, tx, ty) {
   }
 }
 
-})(jQuery);
+}).call(this, this.jQuery);
diff --git a/jquery-turtle.min.js b/jquery-turtle.min.js
new file mode 100644
index 0000000..387546f
--- /dev/null
+++ b/jquery-turtle.min.js
@@ -0,0 +1,5 @@
+(function(a){function b(b,c){if(Ne>5)Oe.push({elem:b,qname:c});else{for(Ne+=1,a.dequeue(b,c);Oe.length>0;){var d=Oe.shift();a.dequeue(d.elem,d.qname),Vc()}Ne-=1}}function c(a,b){function c(){this.constructor=a}for(var d in b)Je.call(b,d)&&(a[d]=b[d]);return c.prototype=b.prototype,a.prototype=new c,a.__super__=b.prototype,a}function d(b){var c,d,e=b.charAt(0).toUpperCase()+b.slice(1),f=["Moz","Webkit","O","ms"],g=document.createElement("div");if(b in g.style)d=b;else for(var h=0;h<0?'"'+a+'"':"'"+a+"'":a}var c=[];for(var d in a)a.hasOwnProperty(d)&&c.push(d+":"+b(a[d])+";");return c.join(" ")}function h(a){return a}function i(a,b){var c=[a[0]*b[0]+a[2]*b[1],a[1]*b[0]+a[3]*b[1]];return 6==a.length&&(c[0]+=a[4],c[1]+=a[5]),c}function j(a,b){var c=[a[0]*b[0]+a[2]*b[1],a[1]*b[0]+a[3]*b[1],a[0]*b[2]+a[2]*b[3],a[1]*b[2]+a[3]*b[3]],d=6==a.length;return 6==b.length?(c.push(a[0]*b[4]+a[2]*b[5]+(d?a[4]:0)),c.push(a[1]*b[4]+a[3]*b[5]+(d?a[5]:0))):d&&(c.push(a[4]),c.push(a[5])),c}function k(a){return Math.abs(a)>1e-12}function l(a){return!(k(a[1])||k(a[2])||k(1-a[0])||k(1-a[3]))}function m(a){if(l(a))return[1,0,0,1];var b=u(a);return k(b[2])?j(o(-b[3]),j(p(1/b[1],1/b[2]),o(-b[0]))):null}function n(a){var b=m(a);if(4==a.length)return b;var c=i(b,[-a[4],-a[5]]);return b.push(c[0]),b.push(c[1]),b}function o(a){var b=Math.cos(a),c=Math.sin(a);return[b,c,-c,b]}function p(a,b){return 1==arguments.length&&(a=b),[a,0,0,b]}function q(a,b){return[a[0]+b[0],a[1]+b[1]]}function r(a,b){return[a[0]-b[0],a[1]-b[1]]}function s(a,b){return[a[0]*b,a[1]*b]}function t(a,b,c){return q(i(a,r(b,c)),c)}function u(a){var b,c,d=a[0]*a[0]+a[1]*a[1],e=a[0]*a[2]+a[1]*a[3],f=a[2]*a[2]+a[3]*a[3],g=-.5*Math.atan2(2*e,d-f),h=Math.cos(g),i=Math.sin(g),j=a[0]*h-a[2]*i,k=a[1]*h-a[3]*i,l=Math.atan2(k,j),m=Math.cos(l),n=Math.sin(l),o=(a[1]*i+a[3]*h)*m-(a[0]*i+a[2]*h)*n,p=(a[0]*h-a[2]*i)*m+(a[1]*h-a[3]*i)*n;return g<-Math.PI/4?(g+=Math.PI/2,c=p,b=o,l-=Math.PI/2):(b=p,c=o),l>Math.PI&&(l-=2*Math.PI),[l,b,c,g]}function v(a,b){var c=(b-a)/2,d=Math.cos(c),e=Math.sin(c),f=d,g=-e,h=1+f*d+g*e,i=f*e-g*d,j=i&&4/3*(Math.sqrt(2*h)-h)/i,k=f-j*g,l=g+j*f,m=k,n=-l,o=c+a,p=Math.cos(o),q=Math.sin(o);return[[k*p-l*q,k*q+l*p],[m*p-n*q,m*q+n*p],[Math.cos(b),Math.sin(b)]]}function w(a){var b=ra(a,!1);if(b)return[b.tx,b.ty];var c=x(a);return c?[c[4],c[5]]:[0,0]}function x(b){var c=Ie.getComputedStyle?Ie.getComputedStyle(b)[Pe]:a.css(b,"transform");if(!c||"none"===c)return null;var d=/^matrix\(([\-+.\de]+),\s*([\-+.\de]+),\s*([\-+.\de]+),\s*([\-+.\de]+),\s*([\-+.\de]+)(?:px)?,\s*([\-+.\de]+)(?:px)?\)$/.exec(c);return d?[parseFloat(d[1]),parseFloat(d[2]),parseFloat(d[3]),parseFloat(d[4]),parseFloat(d[5]),parseFloat(d[6])]:A(c)}function y(b,c){var d,e,f,g="none"===a.css(b,"display");if(g){d={position:"absolute",visibility:"hidden",display:"block"},e={};for(f in d)e[f]=b.style[f],b.style[f]=d[f]}var h=Ie.getComputedStyle?Ie.getComputedStyle(b):null;if(g)for(f in d)b.style[f]=e[f];var i=h&&h[Qe]||a.css(b,"transformOrigin");if(i&&i.indexOf("%")<0)return a.map(i.split(" "),parseFloat);if(c)return[c[0]/2,c[1]/2];var j=a(b);return[j.width()/2,j.height()/2]}function z(a){for(var b,c=[1,0,0,1];null!==a;)b=x(a),b&&!l(b)&&(c=j(b,c)),a=a.parentElement;return c.slice(0,4)}function A(b){var c=[1,0,0,1],d=[],e=[],f=/(?:^\s*|)(\w*)\s*\(([^)]*)\)\s*/g,g=b.replace(f,function(b){return d.push(b[1].toLowerCase()),e.push(a.map(b[2].split(","),function(a){var b=a.trim().toLowerCase();return{num:parseFloat(b),unit:b.replace(/^[+-.\de]*/,"")}})),""});if(g)return null;for(var h=d.length-1;h>=0;--h){var i,k,l,m=null,n=d[h],o=e[h];if("matrix"==n)o.length>=6&&(m=[o[0].num,o[1].num,o[2].num,o[3].num,o[4].num,o[5].num]);else if("rotate"==n)1==o.length&&(i=wa(o[0]),k=Math.cos(i),l=Math.sin(i),m=[k,-l,k,l]);else if("translate"==n||"translatex"==n||"translatey"==n){var p=0,q=0;if(o.length>=1){if(o[0].unit&&"px"!=o[0].unit)return null;if("translate"==n||"translatex"==n?p=o[0].num:"translatey"==n&&(q=o[0].num),"translate"==n&&o.length>=2){if(o[1].unit&&"px"!=o[1].unit)return null;q=o[1].num}m=[0,0,0,0,p,q]}}else if("scale"==n||"scalex"==n||"scaley"==n){var r=1,s=1;o.length>=1&&("scale"==n||"scalex"==n?r=o[0].num:"scaley"==n&&(s=o[0].num),"scale"==n&&o.length>=2&&(s=o[1].num),m=[r,0,0,s,0,0])}else{if("skew"!=n&&"skewx"!=n&&"skewy"!=n)return null;var t=0,u=0;o.length>=1&&("skew"==n||"skewx"==n?t=Math.tan(wa(o[0])):"skewy"==n&&(u=Math.tan(wa(o[0]))),"skew"==n&&o.length>=2&&(u=Math.tan(wa(o[0]))),m=[1,u,t,1,0,0])}c=j(c,m)}return c}function B(a,b,c){if(0>=c)return a;var d=b.pageX-a.pageX,e=b.pageY-a.pageY,f=d*d+e*e;if(c*c>=f)return b;var g=c/Math.sqrt(f);return{pageX:a.pageX+g*d,pageY:a.pageY+g*e}}function C(a,b,c){if(0>=c)b=a;else if(180>c){var d=xa(b-a);d>c?b=a+c:-c>d&&(b=a-c)}return xa(b)}function D(a,b,c,d){return{pageX:Math.floor(a+c/2),pageY:Math.floor(b+d/2)}}function E(a,b,c,d){var e=a+c,f=b+d;return[{pageX:a,pageY:b},{pageX:a,pageY:f},{pageX:e,pageY:f},{pageX:e,pageY:b}]}function F(a){if(!/e[\-+]/.exec(a))return a;var b=a.replace(/(?:\d+(?:\.\d*)?|\.\d+)e[\-+]\d+/g,function(a){return sa(parseFloat(a))});return b}function G(b,c,d){var e=a.data(b,"turtleData");if(e&&e.quickhomeorigin&&e.down&&e.style&&!d&&b.classList&&b.classList.contains("turtle"))return e.quickhomeorigin;var f,g,h,i="none"===a.css(b,"display"),j=i?{position:"absolute",visibility:"hidden",display:"block"}:{},k=(j[Pe]=c?"matrix("+a.map(c,sa).join(", ")+", 0, 0)":"none",{});for(f in j)k[f]=b.style[f],b.style[f]=j[f];g=N(b),h=y(b,[g.width,g.height]);for(f in j)b.style[f]=F(k[f]);d&&(d.gbcr=g,d.localorigin=h);var l=q([g.left,g.top],h);return e&&e.down&&e.style&&(e.quickhomeorigin=l),l}function H(){return Ie.innerHeight||a(Ie).height()}function I(){return Ie.innerWidth||a(Ie).width()}function J(){return document.body?a(document).height():document.height}function K(){return document.body?a(document).width():document.width}function L(a){return a.offsetHeight<=0&&a.offsetWidth<=0}function M(a,b,c,d){return{left:a,top:b,right:a+c,bottom:b+d,width:c,height:d}}function N(b){return mb(b)?M(b.pageX,b.pageY,0,0):a.isWindow(b)?M(a(Ie).scrollLeft(),a(Ie).scrollTop(),I(),H()):9===b.nodeType?M(0,0,K(),J()):"getBoundingClientRect"in b?T.apply(b):M(0,0,0,0)}function O(a,b,c){var d=Math.max(0,Math.max(c.top-a.pageY,a.pageY-c.bottom)),e=Math.max(0,Math.max(c.left-a.pageX,a.pageX-c.right));return e*e+d*d>b}function P(a,b,c){var d=Math.max(c.bottom-a.pageY,a.pageY-c.top),e=Math.max(c.right-a.pageX,a.pageX-c.left);return b>e*e+d*d}function Q(a,b){return b.right=a.top&&b.bottom<=a.bottom&&b.left>=a.left&&b.right<=a.right}function S(a,b){return 4===a.length&&a[0].pageX===b.left&&a[0].pageY===b.top&&a[1].pageX===b.left&&a[1].pageY===b.bottom&&a[2].pageX===b.right&&a[2].pageY===b.bottom&&a[3].pageX===b.right&&a[3].pageY===b.top}function T(){var a=this.getBoundingClientRect();return{top:a.top+Ie.pageYOffset,bottom:a.bottom+Ie.pageYOffset,left:a.left+Ie.pageXOffset,right:a.right+Ie.pageXOffset,width:a.width,height:a.height}}function U(b,c,d,e,f){var g,h,j,k,l=z(b.parentElement),n=m(l),o=G(b,n);if(n){if(a.isNumeric(d)&&(j=w(b),g=q(i(l,j),o),h={pageX:g[0],pageY:g[1]},c=B(h,c,d)),k=i(n,r([c.pageX,c.pageY],o)),e||f){var p=Gc(b);k[0]+=e*p,k[1]-=f*p}return sa(k[0])+" "+sa(k[1])}}function V(a){var b=a.offsetParent;return b?b:document}function W(b,c){c||(c=a(V(b)).pagexy());var d=z(b.parentElement),e=m(d),f=G(b,e),g=ra(b,!0),h=e&&i(e,r([c.pageX,c.pageY],f)),j=1/Gc(b);if(e)return[(g.tx-h[0])*j,(h[1]-g.ty)*j]}function X(b,c){var d,e,f=z(b.parentElement),g=(ra(b,!0),a(V(b)).pagexy()),h=Gc(b),j=[];for(e=0;ei-f&&(d=i-f),f>d&&(d=f),e>j-g&&(e=j-g),g>e&&(e=g);var l={pageX:d,pageY:e};a.isNumeric(c)&&(l=B(k.origin(),l,c)),k.scrollLeft(l.pageX-f),k.scrollTop(l.pageY-g)}function ca(a,b,c){var d=b.pageX-a.pageX,e=b.pageY-a.pageY,f=c.pageX-a.pageX,g=c.pageY-a.pageY;return f*e-d*g}function da(a,b,c){var d=c.pageX-a.pageX,e=c.pageY-a.pageY;return d*b.pageY-b.pageX*e}function ea(a,b){if(b.length<=0)return!1;if(1==b.length)return b[0].pageX==a.pageX&&b[0].pageY==a.pageY;var c=ca(a,b[b.length-1],b[0]);if(0===c)return!0;var d=c>0;if(2==b.length)return!1;for(var e=1;e0!=d)return!1}return!0}function fa(a,b){return{pageX:a.pageX-b.pageX,pageY:a.pageY-b.pageY}}function ga(a,b,c,d){var e,f,g=fa(c,b);for(e=0;e0?1:0>a?-1:0}function ia(a){if(a.length<=2)return 0;var b=ca(a[a.length-1],a[0],a[1]);if(0!==b)return ha(b);for(var c=1;c1&&1!=ha(ca(a[a.length-2],a[a.length-1],b));)a.pop();return a.length&&d(a[a.length-1],b)||a.push(b),a}function c(a,b,c){for(var d=0;db.pageX?1:a.pageYb.pageY?1:0}a.sort(e);var f=c(a,[],b),g=c(a.reverse(),[],b);return f.concat(g.slice(1,-1))}function ma(b){if(!b)return null;if(a.isArray(b))return b;for(var c=a.map(b.trim().split(/\s+/),parseFloat),d=[],e=0;e+1180&&(b-=360),b}function wa(a){return a/180*Math.PI}function xa(a){return Math.abs(a)>180&&(a%=360,a>180?a-=360:-180>=a&&(a+=360)),a}function ya(a){return Math.abs(a)>=720&&(a=a%360+(a>0?360:-360)),a}function za(){return Re.field||Ba(),Re.field}function Aa(){return Re.surface||Ba(),Re.surface}function Ba(){var b=document.createElement("samp"),c=document.createElement("samp"),d=Math.floor(I()/2),e=Math.floor(H()/2);a(b).css({position:"absolute",display:"inline-block",top:0,left:0,width:"100%",height:"100%",font:"inherit",zIndex:-1,transformOrigin:d+"px "+e+"px",pointerEvents:"none",overflow:"hidden"}).addClass("turtlefield"),a(c).attr("id","origin").css({position:"absolute",display:"inline-block",top:e,left:d,width:"100%",height:"0",font:"inherit",transformOrigin:"0px 0px",pointerEvents:"all",turtleSpeed:1/0}).appendTo(b),Re.surface=b,Re.field=c,Ca(),Sb()}function Ca(){document.body?(null==a("html").attr("style")&&a("html").css("min-height","100%"),a(Re.surface).prependTo("body"),Rb()):a(document).ready(Ca)}function Da(a){return a.drawOnCanvas||(a.drawOnCanvas=Fa()),a.drawOnCanvas}function Ea(b){var c=a.data(b,"turtleData");return c?c.drawOnCanvas?c.drawOnCanvas:Re.canvas:null}function Fa(){if(Re.canvas)return Re.canvas;var b=Aa();return Re.canvas=document.createElement("canvas"),a(Re.canvas).css({"z-index":-1}),b.insertBefore(Re.canvas,b.firstChild),Ja(),Ha(Ja),a(Ie).resize(Ja),Re.canvas}function Ga(a,b){return Re.offscreen&&Re.offscreen.width===a&&Re.offscreen.height===b?(Re.offscreen.getContext("2d").clearRect(0,0,a,b),Re.offscreen):(Re.offscreen||(Re.offscreen=document.createElement("canvas")),Re.offscreen.width=a,Re.offscreen.height=b,Re.offscreen)}function Ha(b){var c=a("body"),d=c.width(),e=c.height(),f=function(){(c.width()!=d||c.height()!=e)&&(b(),d=c.width(),e=c.height())};Re.timer&&clearInterval(Re.timer),Re.timer=setInterval(f,250)}function Ia(){var b=a("body");return[Math.max(b.outerWidth(!0),Ie.innerWidth||a(Ie).width()),Math.max(b.outerHeight(!0),Ie.innerHeight||a(Ie).height())]}function Ja(){if(Re.canvas){var b,c=Ia(),d=c[0],e=c[1],f=Re.canvas.width,g=Re.canvas.height,h=Math.max(Math.min(2e3,Math.max(200,f)),100*Math.ceil(d/100))*Re.subpixel,i=Math.max(Math.min(2e3,Math.max(200,f)),100*Math.ceil(e/100))*Re.subpixel;a(Re.surface).css({width:d+"px",height:e+"px"}),(f!=h||g!=i)&&(b=document.createElement("canvas"),b.width=Math.min(f,h),b.height=Math.min(g,i),b.getContext("2d").drawImage(Re.canvas,0,0),Re.canvas.width=h,Re.canvas.height=i,Re.canvas.getContext("2d").drawImage(b,0,0),a(Re.canvas).css({width:h/Re.subpixel,height:i/Re.subpixel}))}}function Ka(a,b){if(!a)return null;if(a&&"function"==typeof a&&(a.helpname||a.name)&&(a=a.helpname||a.name),a=String(a),a.trim&&(a=a.trim()),!a||"none"===a)return null;if("path"===a||"fill"===a)return{savePath:!0};var c=!1;/^erase\b/.test(a)&&(a=a.replace(/^erase\b/,"white; globalCompositeOperation:destination-out"),c=!0);var d=f(a,b);return c&&(d.eraseMode=!0),d}function La(a){return a?g(a):"none"}function Ma(a){return"down"==a||a===!0?!0:"up"==a||a===!1?!1:He}function Na(a){return a?"down":"up"}function Oa(b){var c=a.data(b,"turtleData");return c||(c=a.data(b,"turtleData",{style:null,corners:[[]],path:[[]],down:!1,speed:"turtle",easing:"swing",turningRadius:0,drawOnCanvas:null,quickpagexy:null,quickhomeorigin:null,oldscale:1,instrument:null,stream:null})),c}function Pa(b){var c=a.data(b,"turtleData");return c?c.turningRadius:0}function Qa(){return{get:function(a,b,c){return sa(Pa(a))+"px"},set:function(a,b){var c=parseFloat(b);if(!isNaN(c)&&(Oa(a).turningRadius=c,a.style.turtleTurningRadius=""+sa(c)+"px",0===c)){var d=ra(a,!1);d&&(d.rot>180||d.rot<=-180)&&(d.rot=xa(d.rot),a.style[Pe]=ta(d))}}}}function Ra(){return{get:function(a,b,c){return La(Oa(a).style)},set:function(a,b){var c=Ka(b,"strokeStyle"),d=Oa(a);d.style&&(d.style=null,bb(a,d,!0)),d.style=c,a.style.turtlePenStyle=La(c),bb(a,d,!0)}}}function Sa(){return{get:function(a,b,c){return Na(Oa(a).down)},set:function(a,b){var c=Ma(b);if(c!==He){var d=Oa(a);c!=d.down&&(d.down=c,d.quickpagexy=null,d.quickhomeorigin=null,a.style.turtlePenDown=Na(c),bb(a,d,!0))}}}}function Ta(a,b){return 0===Math.round(a.pageX-b.pageX)&&0===Math.round(a.pageY-b.pageY)}function Ua(a,b){return 0===Math.round(1e3*(a.pageX-b.pageX))&&0===Math.round(1e3*(a.pageY-b.pageY))}function Va(a,b){return Ta(a,b)&&0===Math.round(a.pageX-b.pageX1)&&0===Math.round(a.pageY-b.pageY1)&&0===Math.round(b.pageX2-b.pageX)&&0===Math.round(b.pageY2-b.pageY)}function Wa(a){var b=1e3*a,c=Math.round(b);return Math.abs(c-b)1){h=b[j],f=h.length>2&&Ta(h[0],h[h.length-1])&&!Ta(h[0],h[Math.floor(h.length/2)]),g=f&&!("pageX2"in h[h.length-1]);var k=h[0].pageX,l=h[0].pageY;i.moveTo(k,l);for(var m=1;m1&&(d.length=1),d[0].length&&(d[0].length=0),void(c&&(e?f.length&&f[0].length&&(1==f[0].length?f[0].length=0:f.unshift([])):(f.length>1&&(f.length=1),f[0].length&&(f[0].length=0))));if(c||!e.savePath){var g=Y(a);if(c&&(g.corner=!0,ab(f[0],g)),!e.savePath){ab(d[0],g);var h=Kc(a);$a(Da(b),b.path,e,h,2)}}}}function cb(b,c){var d=Oa(b);d.style&&(c=a.extend({},d.style,c));var e=Kc(b);$a(Da(d),d.corners,c,e,1)}function db(b){if((!b||/\bcanvas\b/.test(b))&&Re.canvas){var c=Re.canvas.getContext("2d");c.save(),c.setTransform(1,0,0,1,0,0),c.clearRect(0,0,Re.canvas.width,Re.canvas.height),c.restore()}if((!b||/\bturtles\b/.test(b))&&Re.surface){var d=a(Re.surface).find(".turtle").not(".turtlefield");pf&&(d=d.not(pf)),d.remove()}if((!b||/\blabels\b/.test(b))&&Re.surface){var d=a(Re.surface).find(".turtlelabel").not(".turtlefield");d.remove()}(!b||/\btext\b/.test(b))&&a("body").contents().not(".turtlefield").remove()}function eb(a,b){if(!a||a.length<1)return null;for(var c=1,d={left:Math.floor(a[0].pageX),top:Math.floor(a[0].pageY),right:Math.ceil(a[0].pageX),bottom:Math.ceil(a[0].pageY)};c=c[3]/2)return!0}else{var o=!c;for(m=0;m0==o)return!0}return!1}function hb(a,b,c){if(b.img)("CANVAS"==a[0].tagName||a[0].tagName==b.img.tagName)&&Kb(b.img,a[0],b.css);else if("IMG"==a[0].tagName||"CANVAS"==a[0].tagName)Hb(a[0],b.url,b.css,c),c=null;else{var d={backgroundImage:"url("+b.url+")",backgroundRepeat:"no-repeat",backgroundPosition:"center"};b.css.width&&b.css.height&&(d.backgroundSize=b.css.width+"px "+b.css.height+"px"),a.css(d)}c&&c()}function ib(b,c,d){var e,f=ra(b,!0),g=f&&wa(f.rot),h=Gc(b),i=f&&c*h,j=f&&(d||0)*h,k=-Math.cos(g)*i,l=Math.sin(g)*i,m=a.data(b,"turtleData");f&&(d&&(k+=Math.sin(g)*j,l+=Math.cos(g)*j),m&&(e=m.quickpagexy)&&(m.quickpagexy={pageX:e.pageX+l,pageY:e.pageY+k}),f.tx+=l,f.ty+=k,b.style[Pe]=ta(f),bb(b,m,!0))}function jb(b,c,d){var e,f=ra(b,!0),g=a.data(b,"turtleData");f&&(g&&(e=g.quickpagexy)&&(g.quickpagexy={pageX:e.pageX+c,pageY:e.pageY-d}),f.tx+=c,f.ty-=d,b.style[Pe]=ta(f),bb(b,g,!0))}function kb(a,b){var c=ra(a,!0);c&&(c.rot+=b,a.style[Pe]=ta(c))}function lb(a,b,c){var d=ra(a,!0);if(d){var e=Gc(a),f=wa(d.rot),g=b*e,h=(c||0)*e,i=-Math.cos(f)*g,j=Math.sin(f)*g;return h&&(i+=Math.sin(f)*h,j+=Math.cos(f)*h),sa(d.tx+j)+" "+sa(d.ty+i)}}function mb(b){return b&&a.isNumeric(b.pageX)&&a.isNumeric(b.pageY)}function nb(){return{get:function(a,b,c){return Oa(a).speed},set:function(b,c){(a.isNumeric(c)&&!(0>=c)||c in a.fx.speeds||""+c=="Infinity")&&(Oa(b).speed=""+c)}}}function ob(){return{get:function(a,b,c){return Oa(a).easing},set:function(b,c){c in a.easing&&(Oa(b).easing=c)}}}function pb(b,c){var d=a.data(b,"turtleData");return c=c||Df,d?a.isNumeric(d.speed)||"Infinity"==d.speed?1e3/d.speed:"turtle"==d.speed&&c?0:d.speed:c?0:"turtle"}function qb(b){var c=a.data(b,"turtleData");return c?c.easing:null}function rb(){return{get:function(a,b,c){var d=ra(a,b),e=y(a);if(d){var f=wa(d.rot),g=Math.cos(f),h=Math.sin(f),i=Gc(a);return sa(((d.tx+e[0])*h-(d.ty+e[1])*g)/i)+"px"}},set:function(b,c){var d,e=ra(b,!0)||{tx:0,ty:0,rot:0,sx:1,sy:1,twi:0},f=y(b),g=Gc(b),h=parseFloat(c)*g,i=wa(e.rot),j=Math.cos(i),k=Math.sin(i),l=(e.tx+f[0])*j+(e.ty+f[1])*k,m=l*j+h*k-f[0],n=l*k-h*j-f[1],o=a.data(b,"turtleData");o&&(d=o.quickpagexy)&&(o.quickpagexy={pageX:d.pageX+(m-e.tx),pageY:d.pageY+(n-e.ty)}),e.tx=m,e.ty=n,b.style[Pe]=ta(e),bb(b,o)}}}function sb(b,c,d,e){return{get:function(a,c,e){var f=ra(a,c);return f?f[b]+d:void 0},set:function(d,f){var g,h=ra(d,!0)||{tx:0,ty:0,rot:0,sx:1,sy:1,twi:0},i={displace:e},j=a.data(d,"turtleData"),k=h.tx,l=h.ty;h[b]=c(f,d,h,i),d.style[Pe]=ta(h),i.displace?(j&&(g=j.quickpagexy)&&(j.quickpagexy={pageX:g.pageX+(h.tx-k),pageY:g.pageY+(h.ty-l)}),bb(d,j)):Z(d)}}}function tb(a,b,c){var d=ya(b-a),e=d>0?c:-c,f=wa(a),g=[Math.cos(f)*e,Math.sin(f)*e],h=wa(b);return{delta:d,sradius:e,dc:g,dx:g[0]-Math.cos(h)*e,dy:g[1]-Math.sin(h)*e}}function ub(a,b,c,d,e,f){var g,h,j,k,l,m,n,o,p,r,t,u=tb(c,d,e),w=u.sradius,x=u.dc;for(n=1,o=u.delta,p=Math.abs(u.delta),p>45&&(n=Math.ceil(p/45),o=u.delta/n),r=[];--n>=0;)g=0===n?d:c+o,h=wa(c+180),j=wa(g+180),r.push.apply(r,v(h,j)),c=g;for(t=[],k=0;k2||(j.length>=1&&(i[c]=parseFloat(j[0])),j.length>=2?i[d]=parseFloat(j[1]):e?i[d]=0:i[d]=i[c],b.style[Pe]=ta(i),e?(k&&(h=k.quickpagexy)&&(k.quickpagexy={pageX:h.pageX+(i.tx-l),pageY:h.pageY+(i.ty-m)}),bb(b,k)):Z(b))}}}function Ab(a){return Se.href=a,Se}function Bb(a){return Ab(a).href}function Cb(a){return/(?:^|\.)pencil(?:code)?\./i.test(a)}function Db(a){var b=Ab(null==a?"":a).hostname,c=/^(\w+)\.pencil(?:code)?\./i.exec(b);return c?c[1]:null}function Eb(a,b){var c=Ab(null==a?"":a),d=c.href;return Cb(c.hostname)?/^\/(?:edit|home|code|load|save)(?:\/|$)/.test(c.pathname)&&(d=c.protocol+"//"+c.host+"/"+b+"/"+c.pathname.replace(/\/[^\/]*(?:\/|$)/,"")+c.search+c.hash):Cb(Ie.location.hostname)&&(d="/proxy/"+d),d}function Fb(a){return/\//.test(a)?a:(a="/img/"+a,Cb(Ie.location.hostname)?a:"//pencilcode.net"+a)}function Gb(){if(!document.cookie)return null;for(var a=document.cookie.split(/;\s*/),b=0;b0&&b.height>0)try{e=c.getContext("2d"),e.clearRect(0,0,b.width,b.height),e.drawImage(b,0,0)}catch(i){}}else c.src=b.src;d&&g.css(d);var j=y(c);if(b&&!d.turtleHull)try{var k=De(b);Ge(k,parseFloat(g.css("width"))/b.width,parseFloat(g.css("height"))/b.height,-j[0],-j[1]),g.css("turtleHull",k)}catch(i){}Lb(c,f,j)}function Lb(b,c,d){var e=a(b);if(e.hasClass("turtle")&&(d[0]!=c[0]||d[1]!=c[1]))if("absolute"==e.css("position")&&/px$/.test(e.css("left"))&&/px$/.test(e.css("top")))e.css("left",parseFloat(e.css("left"))+c[0]-d[0]),e.css("top",parseFloat(e.css("top"))+c[1]-d[1]);else{var f=ra(b,!0);f.tx+=c[0]-d[0],f.ty+=c[1]-d[1],b.style[Pe]=ta(f)}}function Mb(b,c,d,e,f){var g,h,i,j,k;return e===He&&f===He?(g=a(d),g.length?(h=g[0],i=N(h),S(_(h),i)?b.filter(function(){var b=N(this);return c===(R(i,b)||!Q(i,b)&&a(this).inside(h))}):b.filter(function(){return c===a(this).inside(h)})):[]):(j=a.isNumeric(e)&&a.isNumeric(f)?[e,f]:e,a.isArray(j)&&(j=X(b[0]||document.body,[j])[0]),"touch"===d?mb(j)?b.filter(function(){return c===a(this).touches(j)}):(g=a(j),i=N(g[0]),S(_(g[0]),i)?b.filter(function(){var a=N(this);return c===(!Q(i,a)&&(R(i,a)||g.touches(this)))}):b.filter(function(){return c===g.touches(this)})):(k=d*d,b.filter(function(){var a=N(this);if(O(j,k,a))return!c;if(P(j,k,a))return c;var b=Y(this),d=j.pageX-b.pageX,e=j.pageY-b.pageY;return c===k>=d*d+e*e})))}function Nb(){if(!Ze){Ze=!0;try{Ie.parent.document.activeElement.blur()}catch(a){}Ie.focus()}}function Ob(b,c,d,e,f){for(var g=e.split(/\s+/),h=0;h<0?void 0:c.apply(this,arguments)};c.guid&&(d.guid=c.guid),a.handler=d}}function Wb(){Ob(a.event.fixHooks,"filter",a.event.keyHooks,"keydown keyup",Tb),Ob(a.event.fixHooks,"filter",a.event.keyHooks,"keypress",Ub),Ob(a.event.special,"add",{},"keydown keyup keypress",Vb)}function Xb(){return{get:function(a,b,c){return g(Zb(a).getTimbre())},set:function(a,b){Zb(a).setTimbre(f(b,"wave"))}}}function Yb(){return{get:function(a,b,c){return Zb(a).getVolume()},set:function(a,b){Zb(a).setVolume(parseFloat(b))}}}function Zb(b){var c=Oa(b);if(c.instrument)return c.instrument;c.instrument=new ef("piano");var d=a(b);return c.instrument.on("noteon",function(b){var c=a.Event("noteon");c.midi=b.midi,d.trigger(c)}),c.instrument.on("noteoff",function(b){var c=a.Event("noteoff");c.midi=b.midi,d.trigger(c)}),c.instrument}function $b(){return af||(af=new ef),af}function _b(){return!(!Ie.AudioContext&&!Ie.webkitAudioContext)}function ac(){if(ac.audioTop)return ac.audioTop;if(!_b())return null;var a=new(Ie.AudioContext||Ie.webkitAudioContext);return ac.audioTop={ac:a,wavetable:jc(a),out:null,currentStart:null},bc(),ac.audioTop}function bc(){if(ac.audioTop){var a=ac.audioTop;a.out&&(a.out.disconnect(),a.out=null,a.currentStart=null);try{var b=a.ac.createDynamicsCompressor();b.ratio=16,b.attack=5e-4,b.connect(a.ac.destination),a.out=b}catch(c){ac.audioTop=null}}}function cc(){var a=ac();return null!=a.currentStart?a.currentStart:(a.currentStart=Math.max(.25,a.ac.currentTime),setTimeout(function(){a.currentStart=null},0),a.currentStart)}function dc(a){return 440*Math.pow(2,(a-69)/12)}function ec(a){return Math.round(69+12*Math.log(a/440)/Math.LN2)}function fc(a){var b=/^(\^+|_+|=|)([A-Ga-g])([,']*)$/.exec(a);if(!b)return null;var c=b[3].replace(/,/g,"").length-b[3].replace(/'/g,"").length,d=bf[b[2]]+cf[b[1].charAt(0)]*b[1].length+12*c;return d+60}function gc(a){var b=(a-72)%12;(a>60||0!=b)&&(b+=12);for(var c=Math.round((a-b-60)/12),d=df[b];0!=c;)d+=c>0?"'":",",c+=c>0?-1:1;return d}function hc(a){return dc(fc(a))}function ic(a){function b(a,b){switch(a){case"V":A!==z&&c(b.split(" ")[0]);break;case"M":f(b,A);break;case"L":g(b,A);break;case"Q":h(b,A)}A.hasOwnProperty(a)?A[a]+="\n"+b:A[a]=b,"K"==a&&(B=k(b),A===z&&c(d()))}function c(a){a=a||"",(a||A===z)&&(z.voice||(z.voice={}),z.voice.hasOwnProperty(a)?(A=z.voice[a],C=A.accent):(A={id:a,accent:{slurred:0}},z.voice[a]=A,C=A.accent))}function d(){return z.V?z.V.split(/\s+/)[0]:""}function e(a){var e,f=a.match(gf),g=null,h=0,i=0,j=null;if(!f)return null;for(;h/.test(f[h]))i=f[h++].length;else if(/^\(\d+(?::\d+)*/.test(f[h]))j=o(f[h++]);else if(/^[!+].*[!+]$/.test(f[h]))p(f[h++],C);else if(/^.?".*"$/.test(f[h]))h++;else if(/^[()]$/.test(f[h]))"("==f[h++]?C.slurred+=1:(C.slurred-=1,C.slurred<=0&&(C.slurred=0,A.stems&&A.stems.length>=1&&m(A.stems[A.stems.length-1],!1)));else if(/\|/.test(f[h])){for(e in C)1==e.length&&delete C[e];h++}else g=q(f,h,B,C),null!==g?(j&&(n(g.stem,j.time),j.count-=1,j.count||(j=null)),i&&A.stems&&A.stems.length&&(e=i>0?(1-Math.pow(.5,i))*g.stem.time:(Math.pow(.5,-i)-1)*A.stems[A.stems.length-1].time,l(A.stems[A.stems.length-1],e),l(g.stem,-e)),i=0,C.slurred&&m(g.stem,!0),A===z&&c(d()),"stems"in A||(A.stems=[]),A.stems.push(g.stem),h=g.index):h++}function f(a,b){var c=/^C/.test(a)?1:t(a);c&&(b.unitnote||(.75>c?b.unitnote=1/16:b.unitnote=1/8))}function g(a,b){var c=t(a);c&&(b.unitnote=c)}function h(a,b){var c,d=a.split(/\s+|=/),e=null,f=null;for(c=0;c=0||/^[1-4]$/.test(d[c])?e=e||t(d[c]):f=f||Number(d[c]);e&&(b.unitbeat=e),f&&(b.tempo=f)}function i(a){var b,c,d,e,f,g={};for(c=0;c0)for(b=0;a>b&&7>b;++b)d[c.charAt(b)]="^";else for(b=0;b>a&&b>-7;--b)d[c.charAt(6+b)]="_";return d}function k(a){if(!a)return{};var b,c={"c#":7,"f#":6,b:5,e:4,a:3,d:2,g:1,c:0,f:-1,bb:-2,eb:-3,ab:-4,db:-5,gb:-6,cb:-7,"a#m":7,"d#m":6,"g#m":5,"c#m":4,"f#m":3,bm:2,em:1,am:0,dm:-1,gm:-2,cm:-3,fm:-4,bbm:-5,ebm:-6,abm:-7,"g#mix":7,"c#mix":6,"f#mix":5,bmix:4,emix:3,amix:2,dmix:1,gmix:0,cmix:-1,fmix:-2,bbmix:-3,ebmix:-4,abmix:-5,dbmix:-6,gbmix:-7,"d#dor":7,"g#dor":6,"c#dor":5,"f#dor":4,bdor:3,edor:2,ador:1,ddor:0,gdor:-1,cdor:-2,fdor:-3,bbdor:-4,ebdor:-5,abdor:-6,dbdor:-7,"e#phr":7,"a#phr":6,"d#phr":5,"g#phr":4,"c#phr":3,"f#phr":2,bphr:1,ephr:0,aphr:-1,dphr:-2,gphr:-3,cphr:-4,fphr:-5,bbphr:-6,ebphr:-7,"f#lyd":7,blyd:6,elyd:5,alyd:4,dlyd:3,glyd:2,clyd:1,flyd:0,bblyd:-1,eblyd:-2,ablyd:-3,dblyd:-4,gblyd:-5,cblyd:-6,fblyd:-7,"b#loc":7,"e#loc":6,"a#loc":5,"d#loc":4,"g#loc":3,"c#loc":2,"f#loc":1,bloc:0,eloc:-1,aloc:-2,dloc:-3,gloc:-4,cloc:-5,floc:-6,bbloc:-7},d=a.replace(/\s+/g,"").toLowerCase().substr(0,5),e=d.match(/maj|min|mix|dor|phr|lyd|loc|m/);b=e?"maj"==e?d.substr(0,e.index):"min"==e?d.substr(0,e.index+1):d.substr(0,e.index+e[0].length):/^[a-g][#b]?/.exec(d)||"";var f=j(c[b]),g=a.substr(b.length).match(/(_+|=|\^+)[a-g]/gi);if(g)for(var h=0;h<2))switch(a=a.substring(1,a.length-1)){case"pppp":case"ppp":b.dynamics=.2;break;case"pp":b.dynamics=.4;break;case"p":b.dynamics=.6;break;case"mp":b.dynamics=.8;break;case"mf":b.dynamics=1;break;case"f":b.dynamics=1.2;break;case"ff":b.dynamics=1.4;break;case"fff":case"ffff":b.dynamics=1.5}}function q(a,b,c,d){var e,f,g,h,i=[],j="",k=!1,l=null,m=1/0;if(bf&&(j=e,m=f),b0&&"="==a.charAt(0)?a.substr(1):a}function s(a,b,c){var d,e=/^(\^+|_+|=|)([A-Ga-g])(.*)$/.exec(a);return e?(d=e[2].toUpperCase(),e[1].length>0?(c[d]=e[1],r(a)):r(c.hasOwnProperty(d)?c[d]+e[2]+e[3]:b.hasOwnProperty(d)?b[d]+e[2]+e[3]:a)):a}function t(a){var b,c,d,e=/^(\d*)(?:\/(\d*))?$|^(\/+)$/.exec(a),f=0;if(e){if(e[3])return Math.pow(.5,e[3].length);if(c=e[2]?parseFloat(e[2]):/\//.test(a)?2:1,d=0,b=e[1]?parseFloat(e[1]):1,e[2])for(;d+1c;)d+=1,f=parseFloat(e[1].substring(0,d)),b=parseFloat(e[1].substring(d));return f+b/c}}var u,v,w,x,y=a.split("\n"),z={},A=z,B={},C={slurred:0};for(u=0;uc;++c)e[c]=b.real[c],f[c]=b.imag[c];try{return a.createPeriodicWave(e,f)}catch(g){}try{return a.createWaveTable(e,f)}catch(g){}return null}function d(a,b,c){var d,e,f={real:[],imag:[]},g=a.real.length;for(d=0;g>d;++d)e=Math.log(b[Math.min(d,b.length-1)]),f.real.push(a.real[d]*Math.exp(c*e)),f.imag.push(a.imag[d]*Math.exp(c*e));return f}var e,f,g,h,i,j,k={};for(e in b)if(f=b[e],j=c(f)){if(i={wave:j},f.mult)for(h=b[e].freq,i.freq={},g=0;gc;++c)b[c]&&(b[c].constructor===a?e.push.apply(e,b[c].toArray()):a.isArray(b[c])?e.push.apply(e,b[c]):e.push(b[c]));return{elts:a.unique(e),completion:d}}function lc(){function b(){var a,b=g;for(g=null,f&&f(),a=0;a1)for(c=0;c'+a+"
")}function oc(b){var c,d,e=a.extend({},sf,hf,tf);if(b&&!a.isArray(b.helptext)&&b in e&&(b=e[b]),b&&a.isArray(b.helptext)&&b.helptext.length){for(d=0;d/g,'<$1 style="border:1px solid black;text-decoration:none;word-break:keep-all;white-space:nowrap">').replace(/<(mark)>/g,'<$1 style="border:1px solid blue;color:blue;text-decoration:none;word-break:keep-all;white-space:nowrap;cursor:pointer;" onclick="see.enter($(this).text())">'))}return vf}if("number"==typeof b)return nc("Equal to the number "+b+"."),vf;if("boolean"==typeof b)return nc("Equal to the boolean value "+b+"."),vf;if(null===b)return nc("The special null value represents the absence of a value."),vf;if(b===He)return nc("This is an unassigned value."),vf;if(b===Ie)return nc("The global window object represents the browser window."),vf;if(b===document)return nc("The HTML document running the program."),vf;if(b===jQuery)return nc('The jQuery function.  Read about it at jquery.com.'),vf;if(b&&b!=oc)return nc("No help available for "+b),vf;c=[];for(var g in e)!e[g].helptext||!e[g].helptext.length||g in Ie&&"function"!=typeof Ie[g]||c.push(g);return c.sort(function(a,b){return a.length!=b.length?a.length-b.length:b>a?-1:a>b?1:0}),nc("help available for: "+c.map(function(a){return''+a+""}).join(" ")),vf}function pc(a){return 1==a.length&&qc(a[0])&&a[0]}function qc(b){var c;return!(!b||0!=a.queue(b).length||b.parentElement&&b.parentElement.style.transform||0!==(c=pb(b))&&0!==a.fx.speeds[c])}function rc(b,c){var d;if(null==c){if(qc(b))return;d=pb(b)}else d=1e3*c;var e=a(b);d>0&&e.delay(d)}function sc(a,b){if(b=b||0,a.length<=b)return null;var c=a[a.length-1];return"function"!=typeof c||c.helpname?null:c}function tc(b,c,d,e){function f(d,e){if(null!=d){var f=b&&b[d];e&&f&&bb(f,a.data(f,"turtleData"),!0),Hf.reportEvent("resolve",[c,m,j,d,f])}0==--k&&h&&(l?(Me+=1,setTimeout(function(){Me-=1,h()},0)):h())}function g(a){null!=a&&Hf.reportEvent("appear",[c,m,j,a,b&&b[a],i])}var h=sc(d,e),i=h?Array.prototype.slice.call(d,0,d.length-1):d,j=b?b.length||0:0,k=j+1,l=!0,m=Hf.nextId();return Hf.reportEvent("enter",[c,m,j,i]),{name:c,args:i,appear:g,resolve:f,resolver:function(a,b){return function(){f(a,b)}},exit:function(){Hf.reportEvent("exit",[c,m,j,i]),f(null),l=!1}}}function uc(b,c,d,e){var f=function(){if(Vc(b),Le)throw new Error(b+" interrupted");var d,f=tc(this,b,arguments,c),g=[f].concat(a.makeArray(f.args));try{d=e.apply(this,g)}finally{f.exit()}return d};return zc(b,d,f)}function vc(a,b,c){var d=function(){if(Vc(a),Le)throw new Error(a+" interrupted");return Wc(a,this),c.apply(this,arguments)};return zc(a,b,d)}function wc(b,c,d,e){var f=function(){if(Vc(b),Le)throw new Error(b+" interrupted");var c=null,f=0,g=pf;if(e&&(c=e.apply(null,arguments),f=arguments.length,g=Yc()),g){var h=a(pf).eq(0),i=arguments,j=tc(h,b,arguments,f);h.plan(function(a,b){j.appear(a),d.apply(c,i),this.plan(j.resolver(a))}),j.exit()}else j=tc(null,b,arguments,f),d.apply(c,arguments),j.exit();return c?(c.result&&c.result.constructor===jQuery&&pf&&lc(pf,c.result),c.result):void 0};return zc(b,c,f)}function xc(b,c){return zc(b,c,function(c,d){var e=/^key/.test(b),f=/^mouse|click$/.test(b),g=f?"input,button":e?"textarea,input:not([type]),input[type=text],input[type=password]":null;e&&Nb(),null==d&&"function"==typeof c&&(d=c,c=null),a(Ie).on(b+".turtleevent",null,c,g?function(b){return Le||a(b.target).closest(g).length?void 0:d.apply(this,arguments)}:d)})}function yc(){var b=a._data(Ie,"events");if(!b)return!1;for(var c in b)for(var d=b[c],e=0;eb?-c:c,l=null;i.style&&i.down&&(l=function(){var a=Y(h),c=ra(h,!0),d=z(h.parentElement);return function(){ub(i.corners[0],a,c.rot,c.rot+(e?-b:b),k*(i.oldscale?c.sy:1),d)}}()),i.turningRadius=k,this.animate({turtleRotation:g+sa(b)+"deg"},pb(h,f),qb(h)),this.plan(function(){l&&l(),i.turningRadius=j,a.resolve(d,!0)})}),this)}function Bc(a,b){null==b&&(b=100),"bk"===a.name&&(b=-b);var c,d=Df;return(c=pc(this))?(a.appear(0),ib(c,b,0),a.resolve(0,!0),this):(this.plan(function(c,e){a.appear(c),this.animate({turtleForward:"+="+sa(b||0)+"px"},pb(e,d),qb(e),a.resolver(c,!0))}),this)}function Cc(b,c,d){a.isArray(c)&&(d=c[1],c=c[0]),d||(d=0),c||(c=0);var e=Df;return this.plan(function(a,f){b&&b.appear(a),this.animate({turtlePosition:lb(f,d,c)},pb(f,e),qb(f),b&&b.resolver(a,!0))}),this}function Dc(b,c,d){a.isArray(c)&&(d=c[1],c=c[0]),d||(d=0),c||(c=0);var e,f=Df;return(e=pc(this))?(b&&b.appear(0),jb(e,c,d),b&&b.resolve(0),this):(this.plan(function(a,e){b&&b.appear(a);var g=w(e);this.animate({turtlePosition:sa(g[0]+c)+" "+sa(g[1]-d)},pb(e,f),qb(e),b&&b.resolver(a,!0))}),this)}function Ec(b,c,d){var e=c,f=0,g=0,h=null,i=Df;return a.isNumeric(e)&&a.isNumeric(d)?(f=parseFloat(e),g=parseFloat(d),e=null,h=null):a.isArray(e)?(f=e[0],g=e[1],e=null,h=d):a.isNumeric(d)&&(h=d),this.plan(function(c,d){var j=e;if(null===j&&(j=a(V(d)).pagexy()),j&&!mb(j))try{j=a(j).pagexy()}catch(k){return}return j&&mb(j)?a.isWindow(d)?(b&&b.appear(c),ba(j,h),void(b&&b.resolve(c))):void(9!==d.nodeType&&(b&&b.appear(c),this.animate({turtlePosition:U(d,j,h,f,g)},pb(d,i),qb(d),b&&b.resolver(c,!0)))):void 0}),this}function Fc(a){return function(b,c,d){return this.plan(function(e,f){b.appear(e);var g=this.css("turtlePenDown");this.css({turtlePenDown:"up"}),a.call(this,null,c,d),this.plan(function(){this.css({turtlePenDown:g}),b.resolve(e,!0)})}),this}}function Gc(b){var c=a.data(b,"turtleData");return c&&null!=c.oldscale?c.oldscale:1}function Hc(a,b,c){Jc.call(this,!0,a,b,c)}function Ic(a,b,c){Jc.call(this,!1,a,b,c)}function Jc(b,c,d,e){e===He&&(e=d),d&&e||(d=e=1);var f=Df;return this.plan(function(g,h){if(b&&(Oa(h).oldscale*=e),c.appear(g),a.isWindow(h)||9===h.nodeType)return void c.resolve(g);var i=a.map(a.css(h,"turtleScale").split(" "),parseFloat);1===i.length&&i.push(i[0]),i[0]*=d,i[1]*=e,this.animate({turtleScale:a.map(i,sa).join(" ")},pb(h,f),qb(h),c.resolver(g))}),this}function Kc(a,b){var c=z(a.parentElement),d=l(c),e=d?1:u(c)[1];return e*Gc(a)}function Lc(b){var c=Df;return function(d,e,f){if(a.isNumeric(e)){var g=e;e=f,f=g}return null==f&&(f=8.8),this.plan(function(g,h){var i=Oa(h),j=i.style;e||(e=j&&(j.fillStyle||j.strokeStyle)||"black"),d.appear(g);var k=this.pagexy(),l=ra(h,!0),m=Ka(e,"fillStyle"),n=Da(i),o=Kc(h),p=f*o,q=Math.max(0,p-2),r=p+(m.eraseMode?2:0),s=/rgba|hsla/.test(m.fillStyle);null==m.lineWidth&&j&&j.lineWidth&&(m.lineWidth=j.lineWidth),pc(this)?(b(n,k,r,l.rot,m,!0),d.resolve(g)):this.queue(function(e){a({radius:0}).animate({radius:q},{duration:pb(h,c),step:function(){s||b(n,k,this.radius,l.rot,m,!1)},complete:function(){b(n,k,r,l.rot,m,!0),d.resolve(g),e()}})})}),this}}function Mc(a,b,c,d,e){var f=a.getContext("2d");f.save(),Xa(f,e),c===1/0?(f.setTransform(1,0,0,1,0,0),f.fillRect(0,0,a.width,a.height)):(Za(f,a),f.beginPath(),f.arc(b.pageX,b.pageY,c/2,0,2*Math.PI,!1),f.closePath(),f.fill(),e.strokeStyle&&f.stroke()),f.restore()}function Nc(a,b,c,d,e){var f=a.getContext("2d");if(f.save(),Xa(f,e),c===1/0)f.setTransform(1,0,0,1,0,0),f.fillRect(0,0,a.width,a.height);else{var g=Math.sin((d+45)/180*Math.PI),h=Math.cos((d+45)/180*Math.PI),i=c*h/Math.SQRT2,j=c*g/Math.SQRT2;Za(f,a),f.beginPath(),f.moveTo(b.pageX-i,b.pageY-j),f.lineTo(b.pageX-j,b.pageY+i),f.lineTo(b.pageX+i,b.pageY+j),f.lineTo(b.pageX+j,b.pageY-i),f.closePath(),f.fill(),e.strokeStyle&&f.stroke()}f.restore()}function Oc(a,b,c,d,e,f){var g=a.getContext("2d");if(g.save(),Xa(g,e),!e.strokeStyle&&e.fillStyle&&(g.strokeStyle=e.fillStyle),c!==1/0){var h=Math.sin(d/180*Math.PI),i=-Math.cos(d/180*Math.PI),j=e.lineWidth||1.62,k=b.pageX+c*h,l=b.pageY+c*i,m=Pc(j,k,l,h,i),n=c-m.hs,o=n*h,p=n*i;Za(g,a),n>0&&(g.beginPath(),g.moveTo(b.pageX,b.pageY),g.lineTo(b.pageX+o,b.pageY+p),g.stroke()),f&&Qc(g,m)}g.restore()}function Pc(a,b,c,d,e){var f=Math.max(1.25*a,a+2),g=2*f,h=g-f/2;return{hs:h,x1:b,y1:c,xm:b-d*h,ym:c-e*h,x2:b-e*f-d*g,y2:c+d*f-e*g,x3:b+e*f-d*g,y3:c-d*f-e*g}}function Qc(a,b){a.beginPath(),a.moveTo(b.x2,b.y2),a.lineTo(b.x1,b.y1),a.lineTo(b.x3,b.y3),a.quadraticCurveTo(b.xm,b.ym,b.x2,b.y2),a.closePath(),a.fill()}function Rc(a,b,c,d,e,f){var g=e-c,h=f-d,i=Math.sqrt(g*g+h*h),j=g/i,k=h/i,l=Pc(b,e,f,j,k);i>l.hs&&(a.beginPath(),a.moveTo(c,d),a.lineTo(l.xm,l.ym),a.lineWidth=b,a.stroke()),Qc(a,l)}function Sc(a,b){function c(){d&&clearInterval(d),b&&b()}var d=null;if(!Ie.speechSynthesis)return console.log("No speech synthesis: "+a),void c();try{var e=new Ie.SpeechSynthesisUtterance(a);e.addEventListener("end",c),e.addEventListener("error",c),e.lang=navigator.language||"en-GB",Ie.speechSynthesis.speak(e),d=setInterval(function(){Ie.speechSynthesis.pending||Ie.speechSynthesis.speaking||c()},250)}catch(f){Ie.console&&Ie.console.log(f),c()}}function Tc(){a.each(["toggle","show","hide"],function(b,c){var d=a.fn[c];a.fn[c]=function(b,c,e){var f=arguments;!f.length&&this.hasClass("turtle")&&(this.length>1||!a._data(this[0],"fxshow"))&&(f=[0]),d.apply(this,f)}})}function Uc(c,d){if(d||(d="fx"),"IMG"==c.tagName&&c.src&&!c.complete){var e=a.queue(c,d);0==e.length&&(a.queue(c,d,function(a){Ib(c,null,a)}),b(c,d))}}function Vc(b){if(!(a.turtle.hangtime==1/0||kf++<100)){kf=0;var c=(new Date).getTime();return mf?void(c-mf>a.turtle.hangtime&&(Sf.visible()&&Sf.html('Oops: program interrupted because it was hanging the browser. Try reducing the number of repetitions.  Or try using await done defer() or tick to make an animation.'),a.turtle.interrupt("hung"))):(mf=c,clearTimeout(lf),void(lf=setTimeout(function(){clearTimeout(lf),lf=null,mf=null},0)))}}function Wc(b,c){if(!a.turtle.nowarn){var d,e=!0;for(d=0;e&&d=100&&(e=!1);e||(jf[b]||(jf[b]=1,Sf.visible()?Sf.html('Oops: '+b+' may not return useful results when motion is queued. Try speed Infinity or await done defer() first.'):console.warn(b+' may not return useful results when motion is queued.  Try "speed Infinity" or "await done defer()".')),c.finish())}}function Xc(a,b,d){a[b]=function(){return b in jf||(Sf.html(''+b+" deprecated.  Use "+d+"."),jf[b]=1),a[d].apply(this,arguments)},a[d].__super__&&c(a[b],a[d])}function Yc(){return pf&&a.queue(pf).length>0}function Zc(a){if(null===uf.pollTimer){var b=uf.sent[a],c=uf.waiting[a];c&&c.length&&b&&b.length&&(uf.pollTimer=setTimeout(function(){uf.pollTimer=null,c&&c.length&&b&&b.length&&(c.shift().apply(null,b.shift()),Zc(a))},0))}}function $c(a,b){if("function"!=typeof b&&"undefined"!=typeof b||!/^\w+\s*$/.test(a)){if("undefined"==typeof b&&/^help\s+\S+$/.test(a))return oc(/^help\s+(\S+)$/.exec(a)[1]),!0}else{if(b&&b.helptext)return oc(b),!0;if(a in tf)return oc(a),!0}return!1}function _c(a,b,c,d){return a.helptext?d.helptext=a.helptext:b in c&&(d.helptext=c[b].helptext),d.method=a,d.helpname=b,d}function ad(a,b){var c=[];for(var d in b)!b.hasOwnProperty(d)||d in Ie||(c.push(d),Ie[d]=function(b){var c=a[b],d=a;return _c(c,b,tf,function(){return c.apply(d,arguments)})}(d));return c}function bd(){pf=null;for(var a=0;a=0;i--)null===h[i]?(i--,c.moveTo(d-h[i][0],e+h[i][1])):c.lineTo(d-h[i][0],e+h[i][1])}return c.lineWidth=1.1,c.strokeStyle="rgba(255,255,255,0.75)",c.stroke(),c.beginPath(),c.arc(d,e,15.5,0,2*Math.PI,!1),c.closePath(),c.strokeStyle="rgba(0,0,0,0.4)",c.stroke(),b.toDataURL()}function gd(a){var b=Ga(40,48),c=b.getContext("2d");return c.beginPath(),c.moveTo(0,48),c.lineTo(20,0),c.lineTo(40,48),c.lineTo(20,36),c.closePath(),c.fillStyle=a,c.fill(),b.toDataURL()}function hd(a){var b=Ga(40,40),c=b.getContext("2d");return c.beginPath(),c.arc(20,20,18,-5*Math.PI/2,-Math.PI/2),c.closePath(),c.lineTo(20,20),c.stroke(),c.strokeStyle=a,c.lineWidth=4,c.stroke(),b.toDataURL()}function id(a,b){b=b||12;var c=Ga(b,b),d=c.getContext("2d"),e=b/2;return d.beginPath(),d.arc(e,e,e,0,2*Math.PI),d.closePath(),d.fillStyle=a,d.fill(),c.toDataURL()}function jd(a){function b(){e.moveTo(19.5,43),e.lineTo(20.5,43),e.lineTo(21.5,43.5),e.lineTo(25.5,36.2),e.lineTo(24,35.5),e.lineTo(23,35.5),e.lineTo(20.5,36.5),e.lineTo(19.5,36.5),e.lineTo(17,35.5),e.lineTo(16,35.5),e.lineTo(14.5,36.2),e.lineTo(18.5,43.5),e.closePath()}function c(){e.moveTo(25.5,12),e.lineTo(25.5,8),e.lineTo(14.5,8),e.lineTo(14.5,12),e.closePath()}var d=Ga(40,48),e=d.getContext("2d");return e.beginPath(),b(),e.fillStyle="#ffcb6b",e.fill(),e.beginPath(),c(),e.fillStyle="#d1ebff",e.fill(),e.beginPath(),e.moveTo(19.5,48),e.lineTo(13,36),e.lineTo(13,1),e.lineTo(14,0),e.lineTo(26,0),e.lineTo(27,1),e.lineTo(27,36),e.lineTo(20.5,48),e.closePath(),b(),e.moveTo(25.5,12),e.lineTo(25.5,8),e.lineTo(14.5,8),e.lineTo(14.5,12),e.closePath(),e.fillStyle=a,e.fill(),d.toDataURL()}function kd(a,b,c){return c||(c=1),function(d){var e=document.createElement("canvas");e.width=a,e.height=b;var f=e.getContext("2d");d||(d="rgba(128,128,128,0.125)"),"transparent"!=d&&(f.fillStyle=d,f.fillRect(0,0,a,b));var g=a/c,h=b/c,i={width:g,height:h,transformOrigin:g/2+"px + "+h/2+"px",opacity:1};return 1>c&&(i.imageRendering="pixelated"),{img:e,css:i}}}function ld(a){if(!a)return null;if(a in yf)return yf[a];var b=a.match(/^(\d+)x(\d+)(?:\/(\d+))?$/);return b?kd(parseFloat(b[1]),parseFloat(b[2]),b[3]&&parseFloat(b[3])):null}function md(a,b){var c=a.width||a.height||256,d=a.height||a.width||256,e=a.subpixel||1/(a.scale||1),f=a.color||"transparent",g=kd(c,d,e);return g(f)}function nd(b,c){if(!b)return null;if(a.isPlainObject(b))return md(b,c);if(a.isFunction(b)&&(b.helpname||b.name)&&(b=b.helpname||b.name),b.constructor===jQuery){if(!b.length)return null;b=b.get(0)}if(b.tagName)return"CANVAS"!=b.tagName&&"IMG"!=b.tagName&&"VIDEO"!=b.tagName?null:{img:b,css:{opacity:1}};var d=b.toString().trim().split(/\s+/),e=null,f=null;if(d.length&&(f=ld(d[d.length-1]),f&&d.pop()),d.length&&cd(d.join(" "))&&(e=d.join(" "),d.length=0),!f&&e&&(f=ld(c)),f)return f(e);if(/\//.test(b)||(b=Fb(b)),/\//.test(b)){var g=Ab(b).hostname;return!Cb(g)&&Cb(Ie.location.hostname)&&(b=Ie.location.protocol+"//"+Ie.location.host+"/proxy/"+Bb(b)),{url:b,css:{transformOrigin:"50% 50%",opacity:1}}}return null}function od(a){return null==a?"":String(a).replace(/[&<>"]/g,function(a){return zf[a]})}function pd(b,c,d){var e=b&&/^[a-zA-Z]\w*$/.exec(b),f=b&&/^<.*>$/.exec(b),g=nd(b,d)||null==b&&nd(d);e&&a("#"+b).length&&(e=!1);var h;f?h=a(b):g?(h=a("